CAS 4963-01-3

methyl (7alpha,19alpha)-19-methyl-2-oxoformosanan-16-carboxylate

Description:

Methyl (7alpha,19alpha)-19-methyl-2-oxoformosanan-16-carboxylate, with the CAS number 4963-01-3, is a chemical compound that belongs to the class of terpenoids, specifically a type of steroid derivative. This compound features a complex bicyclic structure characterized by multiple chiral centers, which contributes to its stereochemistry and potential biological activity. It typically exhibits a carboxylate functional group, which can influence its solubility and reactivity in various chemical environments. The presence of a methyl group and a ketone functional group suggests that it may participate in various organic reactions, including esterification and oxidation. Such compounds are often studied for their potential applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. The specific biological activities and properties of this compound would depend on its stereochemistry and the presence of functional groups, making it a subject of interest in medicinal chemistry and natural product research.

Formula: C₂₁H₂₄N₂O₄

InChI: InChI=1/C21H24N2O4/c1-12-14-10-23-8-7-21(16-5-3-4-6-17(16)22-20(21)25)18(23)9-13(14)15(11-27-12)19(24)26-2/h3-6,11-14,18H,7-10H2,1-2H3,(H,22,25)/t12-,13-,14+,18-,21-/m0/s1

InChI key: InChIKey=JMIAZDVHNCCPDM-NWQITLLVSA-N

SMILES: O=C1[C@]2([C@]3(N(CC2)C[C@]4([C@](C3)(C(C(OC)=O)=CO[C@H]4C)[H])[H])[H])C=5C(N1)=CC=CC5

Isomitraphylline

CAS: 4963-01-3

Formula: C₂₁H₂₄N₂O₄

Purity: 95%~99%

Molecular weight: 368.433

Ref: BP-BP4897

Isomitraphylline

CAS: 4963-01-3

Isomitraphylline, ideal for standardizing cat's claw meds, inhibits acute lymphoblastic leukemia cell growth.

Formula: C₂₁H₂₄N₂O₄

Purity: 98%

Color and Shape: Solid

Molecular weight: 368.43

Ref: TM-TN4311

Isomitraphylline

CAS: 4963-01-3

Natural alkaloid

Formula: C₂₁H₂₄N₂O₄

Purity: ≥ 90.0 % (HPLC)

Color and Shape: Powder

Molecular weight: 368.43

Ref: 5G-89718

Isomitraphylline

Controlled Product

CAS: 4963-01-3

Applications Isomitraphylline is an oxoindole alkaloid derivied from amazonian plants and maintain medicinal benefits. Used in the treatment of ulcers, arthritis, etc.
References Santos, K., et al.: J. Ethnopharmacol., 194, 108 (2016);

Formula: C₂₁H₂₄N₂O₄

Color and Shape: Neat

Molecular weight: 368.43

Ref: TR-I821363