CAS 4964-76-5
:7-Methoxyquinoline
Description:
7-Methoxyquinoline is an organic compound characterized by a quinoline backbone with a methoxy group (-OCH₃) attached at the 7-position. This compound typically appears as a yellow to brown solid and is known for its aromatic properties due to the presence of the quinoline structure, which consists of a fused benzene and pyridine ring. It is soluble in organic solvents such as ethanol and chloroform but has limited solubility in water. 7-Methoxyquinoline exhibits fluorescence, making it useful in various applications, including as a fluorescent probe in biochemical assays. Additionally, it has been studied for its potential biological activities, including antimicrobial and anticancer properties. The compound's reactivity can be influenced by the methoxy group, which can participate in electrophilic substitution reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 7-Methoxyquinoline is a versatile compound with significant implications in both research and industrial applications.
Formula:C10H9NO
InChI:InChI=1S/C10H9NO/c1-12-9-5-4-8-3-2-6-11-10(8)7-9/h2-7H,1H3
InChI key:InChIKey=IVHJSNNMKJWPFW-UHFFFAOYSA-N
SMILES:O(C)C1=CC2=C(C=C1)C=CC=N2
Synonyms:- Quinoline, 7-Methoxy-
- 7-Methoxyquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Methoxyquinoline
CAS:7-Methoxyquinoline is a drug that belongs to the group of histone deacetylase inhibitors. It has been shown to inhibit monooxygenase and cytochrome p-450, which are enzymes involved in the metabolism of drugs. 7-Methoxyquinoline can be used as a fluorescent probe for reactions involving histones or other proteins with similar chemical structures. It is also used as an inhibitor in biochemical assays, such as fluorometric assays. 7-Methoxyquinoline can be prepared by reacting hydrazine with methoxyacetic acid followed by hydrolysis of the resulting hydrazone. This process yields a mixture of products, some of which are substituted with methoxy groups at different positions on the benzene ring.Formula:C10H9NOPurity:Min. 95%Color and Shape:Colorless PowderMolecular weight:159.18 g/mol




