CAS 4965-09-7
:1-Methyl-1,2,3,4-tetrahydroisoquinoline
Description:
1-Methyl-1,2,3,4-tetrahydroisoquinoline is a bicyclic organic compound characterized by its tetrahydroisoquinoline structure, which consists of a fused benzene and piperidine ring. This compound features a methyl group attached to the nitrogen atom of the piperidine ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential biological activity, including neuroprotective and anti-inflammatory effects, making it of interest in medicinal chemistry and pharmacology. Its molecular formula reflects a relatively simple structure, allowing for various synthetic routes. Additionally, 1-Methyl-1,2,3,4-tetrahydroisoquinoline may exhibit solubility in organic solvents, while its reactivity can be influenced by the presence of the nitrogen atom and the overall ring structure. As with many organic compounds, handling should be done with care, considering safety protocols to avoid exposure or adverse reactions.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-5,8,11H,6-7H2,1H3
InChI key:InChIKey=QPILYVQSKNWRDD-UHFFFAOYSA-N
SMILES:CC1C=2C(CCN1)=CC=CC2
Synonyms:- 1,2,3,4-Tetrahydro-1-methylisoquinoline
- 1-Methyl-1,2,3,4-tetrahydro-isoquinoline
- Isoquinoline, 1,2,3,4-tetrahydro-1-methyl-
- N-Methyl-1,2,3,4-tetrahydroisoquinoline
- 1-Methyl-1,2,3,4-tetrahydroisoquinoline
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
1-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:Formula:C10H13NPurity:>98.0%(T)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:147.221-Methyl-1,2,3,4-tetrahydroisoquinoline, 95%
CAS:1-Methyl-1,2,3,4-tetrahydroisoquinoline (1MeTIQ) is an endogenous antidepressant and parkinsonism-preventing substance that demonstrates neuroprotectiveactivity. Following systemic administration in rats, 1-Methyl-1,2,3,4-tetrahydroisoquinoline produces antidepressant-like effect similar to the effe
Formula:C10H13NPurity:95%Molecular weight:147.221-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:Formula:C10H13NPurity:95%Color and Shape:LiquidMolecular weight:147.21691-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:1-Methyl-1,2,3,4-tetrahydroisoquinoline is an inhibitor of phenylethanolamine N-methyltransferase and can be used in biochemical experiments and drug synthesis.
Formula:C10H13NColor and Shape:SolidMolecular weight:147.221-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:1-Methyl-1,2,3,4-tetrahydroisoquinolineFormula:C10H13NPurity:98%Color and Shape: clear. colourless liquidMolecular weight:147.22g/mol1-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:1-Methyl-1,2,3,4-tetrahydroisoquinoline (1MTI) is a natural compound that has been shown to have serotonergic activity. 1MTI also has glutamate receptor antagonistic effects and has been shown to induce neuronal death in an experimental model of Parkinson’s disease. Monoclonal antibodies against 1MTI have been used to detect the presence of this substance in biological samples, such as cerebrospinal fluid. This drug may be beneficial for the treatment of Parkinson’s disease by reducing dopamine depletion and inhibiting the accumulation of reactive oxygen species.Formula:C10H13NPurity:Min. 95%Molecular weight:147.22 g/mol1-Methyl-1,2,3,4-tetrahydroisoquinoline
CAS:Formula:C10H13NPurity:95%Color and Shape:ClearMolecular weight:147.221






