CAS 4965-09-7: 1-Methyl-1,2,3,4-tetrahydroisoquinoline
Description:1-Methyl-1,2,3,4-tetrahydroisoquinoline is a bicyclic organic compound characterized by its tetrahydroisoquinoline structure, which consists of a fused benzene and piperidine ring. This compound features a methyl group attached to the nitrogen atom of the piperidine ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential biological activity, including neuroprotective and anti-inflammatory effects, making it of interest in medicinal chemistry and pharmacology. Its molecular formula reflects a relatively simple structure, allowing for various synthetic routes. Additionally, 1-Methyl-1,2,3,4-tetrahydroisoquinoline may exhibit solubility in organic solvents, while its reactivity can be influenced by the presence of the nitrogen atom and the overall ring structure. As with many organic compounds, handling should be done with care, considering safety protocols to avoid exposure or adverse reactions.
Formula:C10H13N
InChI:InChI=1S/C10H13N/c1-8-10-5-3-2-4-9(10)6-7-11-8/h2-5,8,11H,6-7H2,1H3
InChI key:InChIKey=QPILYVQSKNWRDD-UHFFFAOYSA-N
SMILES:C=1C=CC2=C(C1)CCNC2C
- Synonyms:
- 1,2,3,4-Tetrahydro-1-methylisoquinoline
- 1-Methyl-1,2,3,4-tetrahydro-isoquinoline
- Isoquinoline, 1,2,3,4-tetrahydro-1-methyl-
- N-Methyl-1,2,3,4-tetrahydroisoquinoline
- 1-Methyl-1,2,3,4-tetrahydroisoquinoline
