CAS 4965-34-8

7-Bromo-2-methylquinoline

Description:

7-Bromo-2-methylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 7-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound is typically a yellow to brown solid and is soluble in organic solvents such as ethanol and dichloromethane, but has limited solubility in water. It exhibits interesting reactivity due to the electron-withdrawing nature of the bromine atom, which can influence its behavior in electrophilic substitution reactions. Additionally, 7-Bromo-2-methylquinoline can serve as a precursor or intermediate in the synthesis of various pharmaceuticals and agrochemicals, owing to its potential biological activity. Its derivatives may exhibit antimicrobial, anti-inflammatory, or anticancer properties, making it a subject of interest in medicinal chemistry. Safety data indicates that, like many brominated compounds, it should be handled with care due to potential toxicity and environmental concerns.

Formula: C₁₀H₈BrN

InChI: InChI=1S/C10H8BrN/c1-7-2-3-8-4-5-9(11)6-10(8)12-7/h2-6H,1H3

InChI key: InChIKey=VEKOCCXFMXGRTF-UHFFFAOYSA-N

SMILES: BrC1=CC2=C(C=CC(C)=N2)C=C1

Synonyms:

• 2-Methyl-7-bromoquinoline
• 7-Bromoquinaldine
• Quinaldine, 7-bromo-
• Quinoline, 7-Bromo-2-Methyl-
• 7-Bromo-2-methylquinoline

7-Bromo-2-methylquinoline

CAS: 4965-34-8

Formula: C₁₀H₈BrN

Purity: 95%

Color and Shape: Solid

Molecular weight: 222.085

Ref: 10-F239091

7-Bromo-2-methylquinoline

CAS: 4965-34-8

Formula: C₁₀H₈BrN

Purity: 96%

Color and Shape: Solid

Molecular weight: 222.0812

Ref: IN-DA00DHW7

7-Bromo-2-methylquinoline

CAS: 4965-34-8

7-Bromo-2-methylquinoline

Formula: C₁₀H₈BrN

Purity: 98%

Color and Shape: light brown powder

Molecular weight: 222.08122g/mol

Ref: 54-OR309220

7-Bromo-2-methylquinoline

CAS: 4965-34-8

7-Bromo-2-methylquinoline is a heterocyclic compound that is selectively activated by protonation. The reaction involves the formation of a carbocation at the carbon atom adjacent to the bromine atom. This intermediate is then attacked by an electrophile, such as an alcohol or a carboxylic acid. The reaction proceeds via an S2 mechanism and can be accelerated by using certain metals as catalysts, such as copper and palladium. 7-Bromo-2-methylquinoline has been used in cross coupling reactions with various arenes to form c–h bonds and halides, which have been analysed through mass spectroscopy.

Formula: C₁₀H₈BrN

Purity: Min. 95%

Molecular weight: 222.08 g/mol

Ref: 3D-EAA96534