CAS 4965-97-3

11-Oxomogrol

Description:

11-Oxomogrol, with the CAS number 4965-97-3, is a chemical compound that belongs to the class of natural products known as terpenoids. It is derived from the plant species of the genus Mangifera, commonly known for their bioactive compounds. This substance is characterized by its unique molecular structure, which includes a ketone functional group at the 11th position of the mogrol backbone. 11-Oxomogrol has garnered interest in the field of medicinal chemistry due to its potential therapeutic properties, including anti-inflammatory and antioxidant activities. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. Additionally, studies have suggested that 11-Oxomogrol may interact with various biological pathways, making it a subject of research for its potential health benefits. However, further studies are necessary to fully elucidate its mechanisms of action and therapeutic efficacy.

Formula: C₃₀H₅₀O₄

InChI: InChI=1S/C30H50O4/c1-18(9-13-24(32)27(4,5)34)19-15-16-28(6)22-12-10-20-21(11-14-23(31)26(20,2)3)30(22,8)25(33)17-29(19,28)7/h10,18-19,21-24,31-32,34H,9,11-17H2,1-8H3/t18-,19-,21-,22+,23+,24-,28+,29-,30+/m1/s1

InChI key: InChIKey=FPMQKXQOBKDVHF-DJHQPCGUSA-N

SMILES: C[C@]12[C@]3([C@](C)([C@]4(C(=CC3)C(C)(C)[C@@H](O)CC4)[H])C(=O)C[C@]1(C)[C@@]([C@@H](CC[C@H](C(C)(C)O)O)C)(CC2)[H])[H]

Synonyms:

• Bryodulcosigenin
• (3β,9β,10α,24R)-3,24,25-Trihydroxy-9-methyl-19-norlanost-5-en-11-one
• 19-Norlanost-5-en-11-one, 3,24,25-trihydroxy-9-methyl-, (3β,9β,10α,24R)-
• 11-Oxomogrol
• NSC 710352

Bryodulcosigenin

CAS: 4965-97-3

Bryodulcosigenin

Purity: ≥98%

Molecular weight: 474.72g/mol

Ref: 54-BUP07324

Bryodulcosigenin

CAS: 4965-97-3

Formula: C₃₀H₅₀O₄

Purity: 95%~99%

Molecular weight: 474.726

Ref: BP-BP1851

Bryodulcosigenin

CAS: 4965-97-3

Bryodulcosigenin has anti-inflammatory effect, it shows potent inhibitory effects on EBV-EA induction.

Formula: C₃₀H₅₀O₄

Purity: 99.96%

Color and Shape: Solid

Molecular weight: 474.72

Ref: TM-TN1455

Bryodulcosigenin

CAS: 4965-97-3

Bryodulcosigenin is a naturally occurring compound classified as a triterpenoid saponin, which is derived from bryophytes, specifically liverworts. This compound is notable for its complex molecular structure and significant biological activities. Bryodulcosigenin operates primarily through its interaction with cellular membranes, which may influence membrane fluidity and permeability, thereby affecting various cellular processes.

Formula: C₃₀H₅₀O₄

Purity: Min. 95%

Molecular weight: 474.7 g/mol

Ref: 3D-EAA96597