CAS 4967-77-5

methyl 2H-1,2,3-triazole-4-carboxylate

Description:

Methyl 2H-1,2,3-triazole-4-carboxylate, with the CAS number 4967-77-5, is a heterocyclic organic compound characterized by its triazole ring structure, which contains three nitrogen atoms and two carbon atoms. This compound features a carboxylate functional group, contributing to its acidic properties, and a methyl ester group, which enhances its solubility in organic solvents. Methyl 2H-1,2,3-triazole-4-carboxylate is known for its potential applications in pharmaceuticals, agrochemicals, and as a building block in organic synthesis due to its ability to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the triazole ring imparts unique electronic properties, making it a valuable scaffold in medicinal chemistry. Additionally, this compound may exhibit biological activity, which is of interest in drug development. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.

Formula: C₄H₅N₃O₂

InChI: InChI=1/C4H5N3O2/c1-9-4(8)3-2-5-7-6-3/h2H,1H3,(H,5,6,7)

SMILES: COC(=O)c1cnn[nH]1

Synonyms:

• 1H-1,2,3-Triazole-4-carboxylic acid, methyl ester
• Methyl 1H-1,2,3-triazole-4-carboxylate

Methyl 1H-1,2,3-triazole-4-carboxylate

CAS: 4967-77-5

Formula: C₄H₅N₃O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 127.1014

Ref: IN-DA003558

Methyl 1,2,3-triazole-4-carboxylate

CAS: 4967-77-5

Methyl 1,2,3-triazole-4-carboxylate

Purity: 97%

Color and Shape: Solid

Molecular weight: 127.10g/mol

Ref: 54-OR951706

methyl 1H-1,2,3-triazole-5-carboxylate

CAS: 4967-77-5

Purity: 97%

Molecular weight: 127.1029968

Ref: 10-F793944

Methyl 1H-1,2,3-triazole-4-carboxylate

CAS: 4967-77-5

Formula: C₄H₅N₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 127.103

Ref: 10-F214614