CymitQuimica logo

CAS 496793-78-3

:

N-[3-(1H-Benzimidazol-2-yl)-4-chlorophenyl]-3,4,5-trimethoxybenzamide

Description:
N-[3-(1H-Benzimidazol-2-yl)-4-chlorophenyl]-3,4,5-trimethoxybenzamide, with the CAS number 496793-78-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzimidazole moiety and a trimethoxybenzamide group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many organic compounds with extensive aromatic systems. It may possess biological activity, potentially acting as a pharmacological agent, given its structural features that are often associated with medicinal chemistry. The presence of multiple methoxy groups can influence its electronic properties and reactivity, while the chlorophenyl group may enhance its lipophilicity. As with many compounds in this category, it is essential to consider its stability under various conditions, potential toxicity, and the specific applications it may have in research or therapeutic contexts. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C23H20ClN3O4
InChI:InChI=1S/C23H20ClN3O4/c1-29-19-10-13(11-20(30-2)21(19)31-3)23(28)25-14-8-9-16(24)15(12-14)22-26-17-6-4-5-7-18(17)27-22/h4-12H,1-3H3,(H,25,28)(H,26,27)
InChI key:InChIKey=WPVPAGJUOPBMCZ-UHFFFAOYSA-N
SMILES:ClC=1C(C=2NC=3C(N2)=CC=CC3)=CC(NC(=O)C4=CC(OC)=C(OC)C(OC)=C4)=CC1
Synonyms:
  • Benzamide, N-[3-(1H-benzimidazol-2-yl)-4-chlorophenyl]-3,4,5-trimethoxy-
  • N-[3-(1H-Benzimidazol-2-yl)-4-chlorophenyl]-3,4,5-trimethoxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.