CAS 496808-09-4

1-[4-(trimethylsilyl)phenyl]piperazine

Description:

1-[4-(Trimethylsilyl)phenyl]piperazine is an organic compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a phenyl group substituted with a trimethylsilyl group enhances its lipophilicity and may influence its solubility and reactivity. The trimethylsilyl group, known for its protective and stabilizing properties, can also affect the compound's volatility and interaction with other chemical species. This compound is typically used in medicinal chemistry and research, particularly in the development of pharmaceuticals, due to its potential biological activity. Its structure suggests that it may interact with various biological targets, making it of interest in the study of neurochemistry and drug design. Additionally, the presence of the piperazine moiety is often associated with compounds that exhibit psychoactive properties. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample.

Formula: C₁₃H₂₂N₂Si

InChI: InChI=1/C13H22N2Si/c1-16(2,3)13-6-4-12(5-7-13)15-10-8-14-9-11-15/h4-7,14H,8-11H2,1-3H3

SMILES: C[Si](C)(C)c1ccc(cc1)N1CCNCC1

Synonyms:

• Piperazine, 1-[4-(trimethylsilyl)phenyl]-

1-(4-Trimethylsilylphenyl)piperazine

CAS: 496808-09-4

Formula: C₁₃H₂₂N₂Si

Purity: 98.0%

Molecular weight: 234.418

Ref: 10-F009857