CAS 496864-15-4
:7-butyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine
Description:
7-butyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine is a heterocyclic organic compound characterized by its complex structure, which includes a pyrrolo[2,3-b]pyrazine core substituted with a butyl group and a 4-methoxyphenyl group. This compound typically exhibits properties associated with heterocycles, such as potential biological activity and solubility in organic solvents. The presence of the methoxy group can enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the butyl substituent may affect the compound's steric properties and overall stability. As a member of the pyrazine family, it may also exhibit interesting electronic properties, making it a candidate for various applications in medicinal chemistry and material science. Its specific characteristics, such as melting point, boiling point, and spectral data, would require empirical measurement or literature reference for precise values. Overall, this compound represents a unique structure that may be of interest in research and development within the fields of pharmaceuticals and organic synthesis.
Formula:C17H19N3O
InChI:InChI=1/C17H19N3O/c1-3-4-5-14-15(12-6-8-13(21-2)9-7-12)20-17-16(14)18-10-11-19-17/h6-11H,3-5H2,1-2H3,(H,19,20)
SMILES:CCCCc1c(c2ccc(cc2)OC)[nH]c2c1nccn2
Synonyms:- 5H-pyrrolo[2,3-b]pyrazine, 7-butyl-6-(4-methoxyphenyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
RP-107
CAS:Formula:C16H17N3OPurity:≥ 97.0%Color and Shape:Off-white to pale yellow solidMolecular weight:267.33RP-106
CAS:RP-106 is an ATP-competitive inhibitor of CDK5/p25, CDK1/cyclin B, and GSK-3.Formula:C17H19N3OPurity:98%Color and Shape:SolidMolecular weight:281.35Aloisine RP106
CAS:Aloisine RP106 is a small-molecule drug that inhibits the activity of lipid kinase, an enzyme involved in tumor angiogenesis. Aloisine RP106 works by inhibiting the production of a protein called death receptor 5, which is a lipid kinase that regulates the growth of new blood vessels. This drug also has anti-angiogenic effects and has been shown to inhibit skin cancer cells and prostate cancer cells in vitro. Aloisine RP106 may be useful for diagnosis and prognosis of various cancers, including liver cancer and melanoma.
Formula:C17H19N3OPurity:Min. 95%Molecular weight:281.35 g/molRef: 3D-FA17321
Discontinued product


