CAS 496864-16-5
:Aloisine A
Description:
Aloisine A is a natural compound classified as a secondary metabolite, specifically belonging to the class of alkaloids. It is derived from certain plant species and is known for its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. The compound has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and anti-inflammatory effects. Aloisine A exhibits a unique stereochemistry, which is crucial for its interaction with biological targets. Its solubility characteristics may vary depending on the solvent used, influencing its bioavailability and efficacy in biological systems. Research into Aloisine A is ongoing, focusing on its mechanisms of action, potential therapeutic applications, and the synthesis of analogs to enhance its properties. As with many natural products, the study of Aloisine A contributes to the broader understanding of plant-derived compounds and their roles in drug discovery and development.
Formula:C16H17N3O
InChI:InChI=1S/C16H17N3O/c1-2-3-4-13-14(11-5-7-12(20)8-6-11)19-16-15(13)17-9-10-18-16/h5-10,20H,2-4H2,1H3,(H,18,19)
InChI key:InChIKey=PRIGRJPRGZCFAS-UHFFFAOYSA-N
SMILES:C(CCC)C1=C(NC=2C1=NC=CN2)C3=CC=C(O)C=C3
Synonyms:- 7-butyl-6-(4-hydroxyphenyl)-5H-pyrrolo[2,3-b]pyrazine
- 7-n-Butyl-6-(4-hydroxyphenyl)[5H]pyrrolo[2,3-b]pyrazine
- Aloisine A
- Phenol, 4-(7-butyl-4H-pyrrolo[2,3-b]pyrazin-6-yl)-
- phenol, 4-(7-butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)-
- 4-(7-Butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4-(7-Butyl-5H-pyrrolo[2,3-b]pyrazin-6-yl)phenol
CAS:Formula:C16H17N3OColor and Shape:SolidMolecular weight:267.3257Aloisine A RP107
CAS:Controlled Product<p>Applications A cell-permeable pyrrolo-pyrazine compound that acts as a potent, selective, reversible, and ATP-competitive inhibitor of cyclin dependent kinases (Cdks: IC50 =150nM, 120 nM, 400 nM and 200 nM for Cdk1/cyclin B, Cdk2/cyclin A, Cdk2/cyclin E, and Cdk5/p25, respectively). Also inhibits the activity of clycogen synthase kinase-3 (GSK-3,:(IC50 =500 nM and 1.5 uM for GSK-3a, GSK-3ß, respectively), and c-Jun N-terminal kinase (JNK: IC50 approx. 3-10uM).<br>References Mattey, Y., et al.: J. Med. Chem., 46, 222 (2003), Noel, S., et al.: J. Pharmacol. Exp. Ther., 319, 349 (2006), Mitsuhashi, M., et al.: Pharm. Res., 25, 1116 (2008),<br></p>Formula:C16H17N3OColor and Shape:NeatMolecular weight:267.33Aloisine A
CAS:Aloisine A, a CDK/GSK-3 inhibitor with IC50: Cdk1/B-150nM, Cdk2/A-120nM, Cdk2/E-400nM, Cdk5/25-200nM, Cdk5/35-160nM, GSK-3α-500nM, GSK-3β-650nM, JNK-3-10μM.Formula:C16H17N3OPurity:98%Color and Shape:SolidMolecular weight:267.33


