CAS 4969-01-1

1,4-dioxaspiro[4.5]decan-7-one

Description:

1,4-Dioxaspiro[4.5]decan-7-one is a cyclic organic compound characterized by its unique spiro structure, which consists of a dioxane ring fused to a decanone framework. This compound features two ether oxygen atoms in a five-membered dioxane ring and a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The spiro arrangement introduces strain and rigidity to the molecule, influencing its physical and chemical properties. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have specific melting and boiling points, which are influenced by their molecular structure. The presence of the dioxane and ketone functionalities can also impart polar characteristics, making them suitable for various chemical reactions, including nucleophilic attacks and condensation reactions. Additionally, 1,4-dioxaspiro[4.5]decan-7-one may serve as a valuable intermediate in the synthesis of more complex organic molecules, particularly in medicinal chemistry and materials science. Its unique structure and functional groups make it a subject of interest for further research and application development.

Formula: C₈H₁₂O₃

InChI: InChI=1/C8H12O3/c9-7-2-1-3-8(6-7)10-4-5-11-8/h1-6H2

SMILES: C1CC(=O)CC2(C1)OCCO2

1,4-dioxaspiro[4.5]decan-9-one

CAS: 4969-01-1

Formula: C₈H₁₂O₃

Purity: 95%

Color and Shape: Liquid

Molecular weight: 156.1791

Ref: IN-DA00DF93

1,4-Dioxaspiro[4.5]decan-7-one

CAS: 4969-01-1

1,4-Dioxaspiro[4.5]decan-7-one

Purity: 98%

Molecular weight: 156.18g/mol

Ref: 54-OR922251

1,4-Dioxa-spiro[4.5]decan-7-one

CAS: 4969-01-1

Formula: C₈H₁₂O₃

Purity: 95%

Color and Shape: Liquid, Oil

Molecular weight: 156.181

Ref: 10-F043881