CAS 49690-09-7

N-tert-butyl-4-nitrobenzenesulfonamide

Description:

N-tert-butyl-4-nitrobenzenesulfonamide is an organic compound characterized by its sulfonamide functional group, which is attached to a nitro-substituted aromatic ring. The presence of the tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. This compound typically exhibits a crystalline solid form at room temperature and has a relatively high melting point due to strong intermolecular interactions. The nitro group contributes to its electron-withdrawing properties, which can influence its reactivity and interactions in various chemical environments. N-tert-butyl-4-nitrobenzenesulfonamide is often utilized in pharmaceutical research and development, particularly in the synthesis of biologically active molecules. Its sulfonamide moiety can participate in various chemical reactions, making it a versatile building block in organic synthesis. Additionally, the compound may exhibit specific biological activities, which are of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₀H₁₄N₂O₄S

InChI: InChI=1/C10H14N2O4S/c1-10(2,3)11-17(15,16)9-6-4-8(5-7-9)12(13)14/h4-7,11H,1-3H3

SMILES: CC(C)(C)NS(=O)(=O)c1ccc(cc1)N(=O)=O

Synonyms:

• Benzenesulfonamide, N-(1,1-dimethylethyl)-4-nitro-
• N-tert-Butyl-4-nitro-benzenesulfonamide

N-tert-Butyl 4-Nitrophenylsulfonamide

CAS: 49690-09-7

Formula: C₁₀H₁₄N₂O₄S

Purity: 97%

Color and Shape: Solid

Molecular weight: 258.2942

Ref: IN-DA003TCX

N-Tert-Butyl 4-Nitrophenylsulfonamide

CAS: 49690-09-7

N-Tert-Butyl 4-Nitrophenylsulfonamide

Purity: 98%

Molecular weight: 258.07g/mol

Ref: 54-OR1014486

N-TERT-BUTYL 4-NITROPHENYLSULFONAMIDE

CAS: 49690-09-7

Formula: C₁₀H₁₄N₂O₄S

Purity: 97%

Molecular weight: 258.29

Ref: 10-F386943

N-tert-Butyl 4-nitrophenylsulfonamide

CAS: 49690-09-7

N-tert-Butyl 4-nitrophenylsulfonamide is a versatile compound with various applications. It can be used as a research chemical in scientific studies or as an ingredient in the synthesis of other compounds. This compound has been found to exhibit antinociceptive properties, making it potentially useful in pain management. Additionally, N-tert-Butyl 4-nitrophenylsulfonamide can act as an electrode material and has been studied for its electrochemical properties. It reacts with certain chemicals such as dioscin, 5-hydroxymethylfurfural (5-HMF), and nicl2, forming new compounds with unique characteristics. Its carbonyl group allows for the formation of N-substituted carbamic acid derivatives, which have shown potential in various fields such as medicinal chemistry and materials science. With its wide range of applications and diverse reactivity, N-tert-Butyl 4-nit

Formula: C₁₀H₁₄N₂O₄S

Purity: Min. 95%

Molecular weight: 258.3 g/mol

Ref: 3D-ZBA69009