CAS 49691-65-8
:2-Chloroacetic acid 2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide
Description:
2-Chloroacetic acid 2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide, with CAS number 49691-65-8, is a chemical compound that features a complex structure incorporating both hydrazide and chloroacetic acid functionalities. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in pharmaceuticals and organic synthesis due to its reactive functional groups. The presence of the chloroacetyl and benzoyl moieties suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the chlorinated aromatic ring may impart specific electronic properties, influencing its reactivity and interaction with biological targets. The compound's hydrazide linkage can also facilitate the formation of hydrazones, which are important in medicinal chemistry. As with many chemical substances, safety precautions should be observed when handling this compound, as it may pose health risks or environmental hazards. Overall, its unique structure and functional groups make it a subject of interest in chemical research and development.
Formula:C18H14Cl3N3O3
InChI:InChI=1S/C18H14Cl3N3O3/c19-9-16(25)23-22-11-24(17(26)10-20)15-7-6-13(21)8-14(15)18(27)12-4-2-1-3-5-12/h1-8,11H,9-10H2,(H,23,25)
InChI key:InChIKey=STLKPHPAWBZAEH-UHFFFAOYSA-N
SMILES:N(C=NNC(CCl)=O)(C(CCl)=O)C1=C(C(=O)C2=CC=CC=C2)C=C(Cl)C=C1
Synonyms:- 2-Chloroacetic acid 2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide
- Acetic acid, 2-chloro-, 2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide
- Acetic acid, chloro-, [[(2-benzoyl-4-chlorophenyl)(chloroacetyl)amino]methylene]hydrazide
- N-(2-benzoyl-4-chlorophenyl)-2-chloro-N-{(E)-[2-(chloroacetyl)hydrazinylidene]methyl}acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
1-Chloroacetyl-2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide
CAS:Applications 1-Chloroacetyl-2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide is a derivative of 2-Amino-5-chlorobenzophenone (A603490); a metabolite of Diazepam (D416855) with a much weaker anticonvulsant effect.
References Hara, T., et al.: J. Med. Chem., 21, 263 (1978)Formula:C18H14Cl3N3O3Color and Shape:NeatMolecular weight:426.681-Chloroacetyl-2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide-d5
CAS:Controlled ProductFormula:C18D5H9Cl3N3O3Color and Shape:NeatMolecular weight:431.7121-Chloroacetyl-2-[[(2-benzoyl-4-chlorophenyl)(2-chloroacetyl)amino]methylene]hydrazide
CAS:Formula:C18H14Cl3N3O3Molecular weight:426.68


