CAS 49694-62-4
:5-deoxy-D-lyxose
Description:
5-deoxy-D-lyxose is a monosaccharide, specifically a deoxysugar, which means it is a sugar molecule that lacks one oxygen atom compared to its parent sugar. This compound is an aldose, characterized by the presence of an aldehyde group (-CHO) at one end of the molecule. 5-deoxy-D-lyxose is a C5 sugar, indicating it contains five carbon atoms. Its structure features a linear form as well as cyclic forms, which can exist in equilibrium in solution. The absence of a hydroxyl group at the 5th carbon distinguishes it from its related sugars, such as D-lyxose. This sugar is of interest in biochemical research and can be involved in various metabolic pathways. It may also serve as a building block for more complex carbohydrates or glycosides. In terms of physical properties, like many sugars, it is likely to be soluble in water and may exhibit sweet taste characteristics. Its applications can extend to fields such as pharmaceuticals and biochemistry, where it may play a role in the synthesis of other compounds.
Formula:C5H10O4
InChI:InChI=1/C5H10O4/c1-3(7)5(9)4(8)2-6/h2-5,7-9H,1H3/t3-,4-,5+/m1/s1
Synonyms:- D-lyxose, 5-deoxy-
- 5-Deoxy-D-lyxose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
5-Deoxy-L-lyxose
CAS:5-Deoxy-L-lyxose is a marine bioactive molecule that belongs to the group of 5-deoxy sugars. Its ring structure is similar to that of ribulose, and it has been found in marine sponges. This compound has a hydroxyl group in its structure and can be oxidized to produce orange pigments. The compound's nmr spectra show it to be an isomer of benzoate, with the sodium salt being more soluble in water than the sodium salts of other 5-deoxy sugars. 5-Deoxy-L-lyxose is also conjugated with amino acids or peptides.Formula:C5H10O4Purity:Min. 95%Molecular weight:134.13 g/mol

