CAS 496946-78-2

5-(trifluoromethyl)-1H-indole-2-carboxylic acid

Description:

5-(Trifluoromethyl)-1H-indole-2-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a trifluoromethyl group (-CF3) at the 5-position of the indole ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. The carboxylic acid functional group (-COOH) at the 2-position contributes to its acidity and reactivity, allowing for various chemical transformations and interactions. This compound is often studied for its potential applications in pharmaceuticals and agrochemicals due to its unique structural features. Additionally, the trifluoromethyl group can impart desirable characteristics such as increased metabolic stability and altered pharmacokinetics. Overall, 5-(trifluoromethyl)-1H-indole-2-carboxylic acid is of interest in medicinal chemistry and material science for its distinctive properties and potential utility in drug development.

Formula: C₁₀H₆F₃NO₂

InChI: InChI=1/C10H6F3NO2/c11-10(12,13)6-1-2-7-5(3-6)4-8(14-7)9(15)16/h1-4,14H,(H,15,16)

SMILES: c1cc2c(cc1C(F)(F)F)cc(C(=O)O)[nH]2

Synonyms:

• 1H-indole-2-carboxylic acid, 5-(trifluoromethyl)-
• 5-(Trifluoromethyl)Indole-2-Carboxylic Acid Ethyl Ester
• 5-(Trifluoromethyl)indole-2-carboxylic acid
• 5-TRIFLUOROMETHYL-1H-INDOLE-2-CARBOXYLIC ACID

5-(Trifluoromethyl)-1H-indole-2-carboxylic acid

CAS: 496946-78-2

Formula: C₁₀H₆F₃NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 229.1553

Ref: IN-DA006YX5

5-Trifluoromethyl-1H-indole-2-carboxylic acid

CAS: 496946-78-2

5-Trifluoromethyl-1H-indole-2-carboxylic acid

Purity: 95%

Molecular weight: 229.16g/mol

Ref: 54-PC408513

5-(Trifluoromethyl)-1H-indole-2-carboxylic acid

CAS: 496946-78-2

Formula: C₁₀H₆F₃NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 229.158

Ref: 10-F236706