CAS 497060-07-8

N-[4-(3,4-Dichlorophenyl)-2-thiazolyl]-3-pyridinamine

Description:

N-[4-(3,4-Dichlorophenyl)-2-thiazolyl]-3-pyridinamine, with the CAS number 497060-07-8, is a chemical compound characterized by its complex structure, which includes a thiazole ring, a pyridine moiety, and a dichlorophenyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many heterocyclic compounds. It may possess biological activity, potentially acting as a pharmaceutical agent or a research chemical, given its structural features that are often associated with various biological interactions. The presence of chlorine atoms in the dichlorophenyl group can influence its reactivity and lipophilicity, affecting how it interacts with biological systems. Additionally, the thiazole and pyridine rings contribute to the compound's electronic properties, which may be relevant in medicinal chemistry. Overall, this compound's unique structure suggests potential applications in drug development or as a biochemical probe, although specific biological activities would require further investigation.

Formula: C₁₄H₉Cl₂N₃S

InChI: InChI=1S/C14H9Cl2N3S/c15-11-4-3-9(6-12(11)16)13-8-20-14(19-13)18-10-2-1-5-17-7-10/h1-8H,(H,18,19)

InChI key: InChIKey=LLBYDZYQNWEDBX-UHFFFAOYSA-N

SMILES: N(C1=NC(=CS1)C2=CC(Cl)=C(Cl)C=C2)C=3C=CC=NC3

Synonyms:

• 3-Pyridinamine, N-[4-(3,4-dichlorophenyl)-2-thiazolyl]-
• N-[4-(3,4-Dichlorophenyl)-2-thiazolyl]-3-pyridinamine

(4-(3,4-dichlorophenyl)(2,5-thiazolyl))-3-pyridylamine

CAS: 497060-07-8

Please enquire for more information about (4-(3,4-dichlorophenyl)(2,5-thiazolyl))-3-pyridylamine including the price, delivery time and more detailed product information at the technical inquiry form on this page

Purity: Min. 95%

Ref: 3D-FD169094