CAS 497060-77-2
:1-[(2,5-Dichlorophenyl)sulfonyl]-4-(2-fluorophenyl)piperazine
Description:
1-[(2,5-Dichlorophenyl)sulfonyl]-4-(2-fluorophenyl)piperazine is a chemical compound characterized by its complex structure, which includes a piperazine ring substituted with both a sulfonyl group and aromatic rings. The presence of the 2,5-dichlorophenyl group contributes to its potential biological activity, while the 2-fluorophenyl moiety may influence its pharmacokinetic properties. This compound is typically classified as a sulfonamide derivative, which can exhibit various biological activities, including potential use in medicinal chemistry. Its molecular structure suggests that it may interact with biological targets through hydrogen bonding and hydrophobic interactions, making it of interest in drug development. The compound's solubility, stability, and reactivity can be influenced by the functional groups present, and it may undergo various chemical reactions typical of piperazine derivatives. Overall, this compound's unique characteristics make it a subject of interest in research, particularly in the fields of pharmacology and medicinal chemistry.
Formula:C16H15Cl2FN2O2S
InChI:InChI=1S/C16H15Cl2FN2O2S/c17-12-5-6-13(18)16(11-12)24(22,23)21-9-7-20(8-10-21)15-4-2-1-3-14(15)19/h1-6,11H,7-10H2
InChI key:InChIKey=BIHKZUVJEWJLNM-UHFFFAOYSA-N
SMILES:FC1=C(N2CCN(S(=O)(=O)C3=C(Cl)C=CC(Cl)=C3)CC2)C=CC=C1
Synonyms:- Piperazine, 1-[(2,5-dichlorophenyl)sulfonyl]-4-(2-fluorophenyl)-
- 1-[(2,5-Dichlorophenyl)sulfonyl]-4-(2-fluorophenyl)piperazine
- 1,4-DICHLORO-2-((4-(2-FLUOROPHENYL)PIPERAZINYL)SULFONYL)BENZENE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.