CAS 49707-23-5
:N-(2,2-Dimethoxyethyl)-2-propenamide
Description:
N-(2,2-Dimethoxyethyl)-2-propenamide, identified by its CAS number 49707-23-5, is an organic compound characterized by its amide functional group and a propenamide structure. This substance features a 2,2-dimethoxyethyl group, which contributes to its unique chemical properties, including potential solubility in various organic solvents. The presence of the propenamide moiety suggests that it may participate in various chemical reactions, such as polymerization or cross-linking, making it of interest in materials science and organic synthesis. Its molecular structure indicates that it may exhibit moderate polarity due to the amide and ether functionalities, influencing its interactions with other compounds. Additionally, the compound's stability and reactivity can be affected by environmental factors such as temperature and pH. While specific physical properties like melting point, boiling point, and density are not detailed here, they are essential for practical applications and should be referenced from reliable chemical databases or literature for precise information. Overall, N-(2,2-Dimethoxyethyl)-2-propenamide is a versatile compound with potential applications in various fields.
Formula:C7H13NO3
InChI:InChI=1S/C7H13NO3/c1-4-6(9)8-5-7(10-2)11-3/h4,7H,1,5H2,2-3H3,(H,8,9)
InChI key:InChIKey=CMMYGCUEJWTBCG-UHFFFAOYSA-N
SMILES:C(CNC(C=C)=O)(OC)OC
Synonyms:- (2,2-Dimethoxyethyl)acrylamide
- 2-propenamide, N-(2,2-dimethoxyethyl)-
- Acrylamidoacetaldehyde dimethyl acetal
- N-(2,2-Dimethoxyethyl)-2-propenamide
- N-(2,2-Dimethoxyethyl)acrylamide
- N-Acryloylaminoacetaldehyde dimethyl acetal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
N-(2,2-Dimethoxyethyl)prop-2-enamide
CAS:Controlled ProductFormula:C7H13NO3Color and Shape:NeatMolecular weight:159.18
