CAS 497084-46-5: 3-Iodo-8-nitro-quinoline
Description:3-Iodo-8-nitro-quinoline is a chemical compound characterized by its unique structure, which includes a quinoline core substituted with both an iodine atom and a nitro group. The presence of the iodine atom typically imparts certain reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The nitro group, known for its electron-withdrawing properties, can influence the compound's electronic characteristics and reactivity, often enhancing its potential as a pharmacophore in medicinal chemistry. This compound may exhibit biological activity, making it of interest in drug development and research. Additionally, its molecular structure suggests potential applications in materials science and organic synthesis. As with many halogenated and nitro-substituted compounds, safety and handling precautions are essential due to potential toxicity and environmental concerns. Overall, 3-Iodo-8-nitro-quinoline represents a versatile compound with implications in various fields of chemistry and biochemistry.
Formula:C9H5IN2O2
InChI:InChI=1/C9H5IN2O2/c10-7-4-6-2-1-3-8(12(13)14)9(6)11-5-7/h1-5H
- Synonyms:
- 3-Iodo-8-nitroquinoline
- Quinoline, 3-Iodo-8-Nitro-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 3-Iodo-8-nitro-quinoline REF: IN-DA00DGFSCAS: 497084-46-5 | 95% | To inquire | Thu 10 Apr 25 |
![]() | 3-Iodo-8-nitroquinoline REF: 54-OR303033CAS: 497084-46-5 | - - - | To inquire | Thu 17 Apr 25 |
![]() | 3-Iodo-8-nitroquinoline REF: 10-F217984CAS: 497084-46-5 | 95.0% | To inquire | Tue 22 Apr 25 |
![]() | 3-Iodo-8-nitroquinoline REF: 3D-FI139045CAS: 497084-46-5 | Min. 95% | - - - | Discontinued product |

Ref: IN-DA00DGFS
1g | 535.00 € | ||
2g | 613.00 € | ||
5g | To inquire | ||
100mg | 157.00 € | ||
250mg | 202.00 € | ||
500mg | 282.00 € |

Ref: 54-OR303033
Undefined size | To inquire |

3-Iodo-8-nitroquinoline
Ref: 10-F217984
1g | To inquire | ||
2g | To inquire | ||
5g | To inquire | ||
100mg | To inquire | ||
250mg | To inquire | ||
500mg | To inquire |

3-Iodo-8-nitroquinoline
Ref: 3D-FI139045
100g | Discontinued | Request information | |
250g | Discontinued | Request information |