CAS 49710-99-8
:1-(2-Hydroxy-5-methoxyphenyl)-1-propanone
Description:
1-(2-Hydroxy-5-methoxyphenyl)-1-propanone, also known by its CAS number 49710-99-8, is an organic compound characterized by its phenolic structure and ketone functional group. This substance features a propanone moiety attached to a phenolic ring that has both a hydroxyl (-OH) and a methoxy (-OCH3) group, contributing to its chemical reactivity and potential biological activity. The presence of the hydroxyl group enhances its solubility in polar solvents, while the methoxy group can influence its electronic properties and steric hindrance. This compound may exhibit antioxidant properties and has been studied for its potential applications in pharmaceuticals and cosmetics. Its molecular structure suggests it could participate in various chemical reactions, including oxidation and substitution reactions. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 1-(2-Hydroxy-5-methoxyphenyl)-1-propanone is of interest in both synthetic organic chemistry and medicinal chemistry due to its unique functional groups and potential applications.
Formula:C10H12O3
InChI:InChI=1/C10H12O3/c1-3-9(11)8-6-7(13-2)4-5-10(8)12/h4-6,12H,3H2,1-2H3
InChI key:InChIKey=MLDZAGGFWSAWHF-UHFFFAOYSA-N
SMILES:C(CC)(=O)C1=CC(OC)=CC=C1O
Synonyms:- 1-(2-Hydroxy-5-Methoxyphenyl)Propan-1-One
- 1-(2-Hydroxy-5-methoxyphenyl)-1-propanone
- 1-Propanone, 1-(2-hydroxy-5-methoxyphenyl)-
- Brn 1944126
- Propiophenone, 2'-hydroxy-5'-methoxy-
- 2′-Hydroxy-5′-methoxypropiophenone
- 2-Hydroxy-5'-methoxypropiophenone
- Methoxamine Impurity 18
- Methoxamine Impurity 7 HCl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
1-(2-Hydroxy-5-methoxyphenyl)-1-propanone
CAS:Controlled ProductApplications 1-(2-hydroxy-5-methoxyphenyl)propan-1-one (cas# 49710-99-8) is a useful research chemical.
Formula:C10H12O3Color and Shape:NeatMolecular weight:180.2

