CAS 497178-55-9

4-thiophen-2-yl-2,3-dihydro-1H-1,5-benzodiazepine

Description:

4-Thiophen-2-yl-2,3-dihydro-1H-1,5-benzodiazepine is a chemical compound that belongs to the benzodiazepine class, which is characterized by a fused benzene and diazepine ring structure. This specific compound features a thiophene ring, which is a five-membered heterocyclic aromatic ring containing sulfur. The presence of the thiophene moiety can influence the compound's electronic properties and biological activity. Typically, benzodiazepines exhibit pharmacological effects such as anxiolytic, sedative, and anticonvulsant properties, although the specific activity of this compound would depend on its structural nuances and substituents. The dihydro form indicates that the compound has two hydrogen atoms added to the benzodiazepine structure, which may affect its stability and reactivity. The CAS number 497178-55-9 serves as a unique identifier for this substance, facilitating its recognition in chemical databases and literature. Overall, the characteristics of this compound suggest potential applications in medicinal chemistry, particularly in the development of new therapeutic agents.

Formula: C₁₃H₁₂N₂S

InChI: InChI=1/C13H12N2S/c1-2-5-11-10(4-1)14-8-7-12(15-11)13-6-3-9-16-13/h1-6,9,14H,7-8H2

SMILES: c1ccc2c(c1)NCCC(=N2)c1cccs1

Synonyms:

• 1H-1,5-benzodiazepine, 2,3-dihydro-4-(2-thienyl)-
• 4-(2-Thienyl)-2,3-dihydro-1H-1,5-benzodiazepin
• 4-(2-Thienyl)-2,3-dihydro-1H-1,5-benzodiazepine

2,3-Dihydro-4-thien-2-yl-1H-1,5-benzodiazepine

CAS: 497178-55-9

2,3-Dihydro-4-thien-2-yl-1H-1,5-benzodiazepine

Purity: ≥95%

Ref: 54-OR01551

4-(thiophen-2-yl)-2,3-dihydro-1H-1,5-benzodiazepine

CAS: 497178-55-9

Purity: 95.0%

Molecular weight: 228.30999755859375

Ref: 10-F526116