CAS 4972-31-0
:1-(phenylsulfinyl)piperidine
Description:
1-(Phenylsulfinyl)piperidine, with the CAS number 4972-31-0, is an organic compound characterized by the presence of a piperidine ring substituted with a phenylsulfinyl group. This compound typically exhibits a white to off-white crystalline appearance. The piperidine ring contributes to its cyclic amine properties, which can influence its reactivity and interaction with biological systems. The phenylsulfinyl group introduces a sulfoxide functionality, which can enhance the compound's polarity and solubility in various solvents. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its structure allows for potential interactions with biological targets, and it may participate in various chemical reactions, including oxidation and nucleophilic substitution. The presence of both the piperidine and sulfinyl moieties suggests that it could serve as a versatile building block in organic synthesis or as a lead compound in drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H15NOS
InChI:InChI=1/C11H15NOS/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1,3-4,7-8H,2,5-6,9-10H2
SMILES:c1ccc(cc1)S(=O)N1CCCCC1
Synonyms:- 1-(Benzenesulfinyl)Piperidine
- Piperidine, 1-(Phenylsulfinyl)-
- 1-(Phenylsulfinyl)piperidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
1-(Phenylsulfinyl)piperidine
CAS:Formula:C11H15NOSPurity:95%Color and Shape:SolidMolecular weight:209.30791-(Phenylsulphinyl)piperidine
CAS:1-(Phenylsulphinyl)piperidinePurity:98%Molecular weight:209.31g/mol1-(Phenylsulfonyl)piperidine
CAS:1-(Phenylsulfonyl)piperidine is an activated diphenyl sulfoxide that can be used as a glycosidic bond donor in the solid-phase synthesis of peptides. It reacts with chloride ions to form a sulfonium ion, which undergoes electrophilic substitution. 1-(Phenylsulfonyl)piperidine has been used in the synthesis of the blood group A antigen and the hydroxy group is used for the synthesis of glycosides and amino acids. This compound also has stereoselective properties for sulfoxides, carbon tetrachloride, hydroxyl groups, dodecyl groups, and acceptors.Formula:C11H15NOSPurity:Min. 95%Color and Shape:PowderMolecular weight:209.31 g/mol1-(Phenylsulfinyl)piperidine
CAS:Controlled ProductApplications 1-(Phenylsulfonyl)piperidine (CAS# 4972-31-0) is a useful research chemical compound.
Formula:C11H15NOSColor and Shape:NeatMolecular weight:209.31




