CAS 497223-25-3: Cenicriviroc
Description:Cenicriviroc is a small molecule that functions as an antagonist of the CCR5 and CCR2 chemokine receptors, which are involved in inflammatory processes and HIV infection. It is primarily investigated for its potential therapeutic applications in treating HIV and non-alcoholic steatohepatitis (NASH). The compound exhibits a unique mechanism of action by blocking the entry of HIV into host cells and modulating immune responses associated with liver inflammation. Cenicriviroc is characterized by its relatively low molecular weight and specific structural features that enable its receptor-binding capabilities. In preclinical and clinical studies, it has shown promise in reducing liver inflammation and fibrosis, making it a candidate for further research in liver-related diseases. Its pharmacokinetic profile indicates that it can be administered orally, and it has been evaluated for safety and efficacy in various clinical trials. As with any investigational drug, ongoing studies are essential to fully understand its therapeutic potential and long-term effects.
Formula:C41H52N4O4S
InChI:InChI=1S/C41H52N4O4S/c1-5-7-22-48-23-24-49-38-15-10-32(11-16-38)33-12-19-40-35(25-33)26-34(9-8-21-44(40)28-31(3)4)41(46)43-36-13-17-39(18-14-36)50(47)29-37-27-42-30-45(37)20-6-2/h10-19,25-27,30-31H,5-9,20-24,28-29H2,1-4H3,(H,43,46)/t50-/m0/s1
InChI key:InChIKey=PNDKCRDVVKJPKG-DPDRHGIRSA-N
SMILES:O=C(NC1=CC=C(C=C1)S(=O)CC2=CN=CN2CCC)C3=CC4=CC(=CC=C4N(CCC3)CC(C)C)C=5C=CC(OCCOCCCC)=CC5
- Synonyms:
- (-)-8-[4-(2-Butoxyethoxy)phenyl]-1-isobutyl-N-[4-[[(1-propyl-1H-imidazol-5-yl)methyl]sulfinyl]phenyl]-1,2,3,4-tetrahydro-1-benzazocine-5-carboxamide
- TB 652
- 8-[4-(2-Butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-(2-methylpropyl)-N-[4-[(S)-[(1-propyl-1H-imidazol-5-yl)methyl]sulfinyl]phenyl]-1-benzazocine-5-carboxamide
- Cenicriviroc
- 1-Benzazocine-5-carboxamide, 8-[4-(2-butoxyethoxy)phenyl]-1,2,3,4-tetrahydro-1-(2-methylpropyl)-N-[4-[(S)-[(1-propyl-1H-imidazol-5-yl)methyl]sulfinyl]phenyl]-
