CAS 49746-10-3
:sodium 2-(2,4,5,7-tetraiodo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate hydrate (2:1:1)
Description:
Sodium 2-(2,4,5,7-tetraiodo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate hydrate (2:1:1), with CAS number 49746-10-3, is a complex organic compound characterized by its unique structure that includes a xanthenone moiety substituted with multiple iodine atoms, which contributes to its distinctive color and potential applications in dye chemistry. The presence of the sodium salt form indicates its solubility in water, making it useful in various aqueous applications. The compound exhibits properties typical of xanthene derivatives, including fluorescence, which can be influenced by the degree of iodination. Its hydrate form suggests that it contains water molecules in its crystalline structure, which can affect its stability and solubility. This compound may find applications in fields such as photochemistry, biological imaging, and as a dye in various industrial processes. However, due to the presence of iodine, it may also exhibit specific biological activities or toxicity that require careful handling and consideration in its use.
Formula:C20H8I4Na2O6
InChI:InChI=1/C20H8I4O5.2Na.H2O/c21-11-5-9-13(7-3-1-2-4-8(7)20(27)28)10-6-12(22)17(26)15(24)19(10)29-18(9)14(23)16(11)25;;;/h1-6,25H,(H,27,28);;;1H2/q;2*+1;/p-2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
