CymitQuimica logo

CAS 49754-15-6

:

diethyl (1,3-dioxopropane-1,3-diyl)biscarbamate

Description:
Diethyl (1,3-dioxopropane-1,3-diyl)biscarbamate, with the CAS number 49754-15-6, is an organic compound characterized by its carbamate functional groups. This substance features a dioxopropane backbone, which contributes to its structural complexity and potential reactivity. The presence of two diethyl carbamate moieties suggests that it may exhibit properties typical of carbamates, such as being a potential insecticide or herbicide, as many carbamate compounds are known for their biological activity. The compound is likely to be a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It may be soluble in organic solvents but has limited solubility in water due to its hydrophobic diethyl groups. The compound's stability, reactivity, and potential applications can be influenced by factors such as temperature, pH, and the presence of other chemicals. Safety data should be consulted for handling and exposure risks, as carbamates can be toxic to humans and wildlife.
Formula:C9H14N2O6
InChI:InChI=1/C9H14N2O6/c1-3-16-8(14)10-6(12)5-7(13)11-9(15)17-4-2/h3-5H2,1-2H3,(H,10,12,14)(H,11,13,15)
InChI key:DPOPJTBOMCSYAQ-UHFFFAOYSA-N
SMILES:CCOC(=O)N=C(CC(=NC(=O)OCC)O)O
Synonyms:
  • Carbamic acid, (1,3-dioxo-1,3-propanediyl)bis-, diethyl ester
Found 5 products.