CymitQuimica logo

CAS 49783-84-8

:

1,5-dimethyl-1H-pyrazole-3-carbonyl chloride

Description:
1,5-Dimethyl-1H-pyrazole-3-carbonyl chloride is a chemical compound characterized by its pyrazole ring structure, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound features two methyl groups attached to the first position of the pyrazole ring and a carbonyl chloride functional group at the third position. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the carbonyl chloride group indicates that it is a reactive compound, capable of participating in acylation reactions and serving as an acylating agent. This compound is often used in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its reactivity and structural features make it a valuable intermediate in chemical reactions. Additionally, safety precautions should be taken when handling this compound due to its potential hazards, including irritant properties and reactivity with water, which can lead to the release of hydrochloric acid.
Formula:C6H7ClN2O
InChI:InChI=1/C6H7ClN2O/c1-4-3-5(6(7)10)8-9(4)2/h3H,1-2H3
InChI key:BADBQYAILRGCBB-UHFFFAOYSA-N
SMILES:Cc1cc(C(=O)Cl)nn1C
Found 4 products.