CAS 49792-23-6
:Medicagenic acid 3-O-β-D-glucopyranoside
Description:
Medicagenic acid 3-O-β-D-glucopyranoside is a glycoside derived from medicagenic acid, which is a triterpenoid compound found in various plants, particularly in the legume family. This compound features a glucopyranoside moiety, indicating that a glucose molecule is attached to the medicagenic acid via a glycosidic bond at the 3-position. The presence of the glucopyranoside enhances the solubility and bioavailability of the medicagenic acid, potentially influencing its pharmacological properties. Medicagenic acid itself is known for various biological activities, including anti-inflammatory and antioxidant effects. The glycosylation may also affect the compound's stability and interaction with biological systems. As a chemical entity, it is characterized by its molecular structure, which includes a triterpenoid backbone and a sugar unit, contributing to its functional properties. The CAS number 49792-23-6 uniquely identifies this compound in chemical databases, facilitating its study and application in research and potential therapeutic contexts.
Formula:C36H56O11
InChI:InChI=1/C36H56O11/c1-31(2)11-13-36(30(44)45)14-12-33(4)18(19(36)15-31)7-8-22-32(3)16-20(38)27(35(6,29(42)43)23(32)9-10-34(22,33)5)47-28-26(41)25(40)24(39)21(17-37)46-28/h7,19-28,37-41H,8-17H2,1-6H3,(H,42,43)(H,44,45)/t19-,20+,21-,22-,23?,24-,25+,26-,27+,28+,32-,33-,34-,35?,36+/m1/s1
InChI key:InChIKey=XCHARIIIZLLEBL-HXZZEOLJSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)([C@@](C(O)=O)(C)[C@@H](O[C@@H]4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)[C@@H](O)C3)[H])(CC=C5[C@@]2(C)CC[C@]6(C(O)=O)[C@]5(CC(C)(C)CC6)[H])[H]
Synonyms:- G 2
- Medicagenic acid 3-O-β-D-glucopyranoside
- (2β,3β,4α)-3-(β-D-Glucopyranosyloxy)-2-hydroxyolean-12-ene-23,28-dioic acid
- Olean-12-ene-23,28-dioic acid, 3β-(β-D-glucopyranosyloxy)-2β-hydroxy-
- Olean-12-ene-23,28-dioic acid, 3-(β-D-glucopyranosyloxy)-2-hydroxy-, (2β,3β,4α)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Medicagenic acid 3-O-glucoside
CAS:Medicagenic acid 3-O-glucoside is a bioactive phytochemical compound, which is a type of saponin glucoside. It is derived from the genus Medicago, particularly from species such as alfalfa, known for their medicinal and nutritional properties. The mode of action of Medicagenic acid 3-O-glucoside involves interactions with cellular membranes, where it can influence permeability and modulate immune responses. These interactions are attributed to its surfactant properties that enable the saponin to disrupt lipid bilayers and influence signal transduction pathways that mediate inflammatory and immune processes.Formula:C36H56O11Purity:Min. 95%Color and Shape:PowderMolecular weight:664.82 g/mol
