CAS 498-15-7: (+)-3-Carene
Description:(+)-3-Carene is a bicyclic monoterpene with the molecular formula C10H16, characterized by its unique structure that includes a cyclohexene ring fused to a cyclopropane. It is a colorless liquid at room temperature, exhibiting a pleasant, pine-like aroma, which makes it a valuable compound in the fragrance and flavor industries. (+)-3-Carene is known for its potential therapeutic properties, including anti-inflammatory and analgesic effects, and is often studied for its role in traditional medicine and aromatherapy. The compound is soluble in organic solvents but has limited solubility in water. Its boiling point is relatively low, making it volatile, and it can be found in various essential oils, particularly those derived from coniferous trees. Additionally, (+)-3-Carene is utilized in the synthesis of other organic compounds and can serve as a precursor in the production of various chemical products. Safety data indicates that it should be handled with care, as it may cause skin irritation or respiratory issues upon exposure.
Formula:C10H16
InChI:InChI=1S/C10H16/c1-7-4-5-8-9(6-7)10(8,2)3/h4,8-9H,5-6H2,1-3H3/t8-,9+/m1/s1
InChI key:InChIKey=BQOFWKZOCNGFEC-BDAKNGLRSA-N
SMILES:C1=C(C)CC2C(C1)C2(C)C
- Synonyms:
- (+)-Carene-3
- (+)-delta3-Carene
- (+)-Δ<sup>3</sup>-Carene
- (1S)-(+)-3-Carene
- (1S)-3,7,7-Trimethylbicyclo(4.1.0)hept-3-ene
- (1S,6R)-3,7,7-trimethylbicyclo[4.1.0]hept-3-ene
- (1S,6R)-3-Carene
- (S)-(+)-3-Carene
- 3-Carene, (1S,6R)-(+)-
- Bicyclo(4.1.0)hept-3-ene, 3,7,7-trimethyl-, (1S)-
- See more synonyms
- Bicyclo(4.1.0)hept-3-ene, 3,7,7-trimethyl-, (1S,6R)-
- Einecs 207-856-6
- Isodiprene