CAS 498-17-9

2,2'-(ethylenediimino)dibutyric acid

Description:

2,2'-(Ethylenediimino)dibutyric acid, with the CAS number 498-17-9, is a chemical compound characterized by its structure, which includes two butyric acid moieties linked by an ethylenediimino group. This compound typically exhibits properties associated with both amines and carboxylic acids, making it a versatile molecule in various chemical applications. It is often used as a chelating agent due to its ability to form stable complexes with metal ions, which is valuable in fields such as coordination chemistry and materials science. The presence of multiple functional groups allows for potential reactivity in organic synthesis, enabling the formation of diverse derivatives. Additionally, its solubility in polar solvents can facilitate its use in biological and environmental studies. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken. Overall, 2,2'-(ethylenediimino)dibutyric acid is a significant compound in both industrial and research contexts due to its unique chemical properties.

Formula: C₁₀H₂₀N₂O₄

InChI: InChI=1/C10H20N2O4/c1-3-7(9(13)14)11-5-6-12-8(4-2)10(15)16/h7-8,11-12H,3-6H2,1-2H3,(H,13,14)(H,15,16)

SMILES: CCC(C(=O)O)NCCNC(CC)C(=O)O

2,2′-(Ethylenediimino)dibutyric acid

CAS: 498-17-9

Formula: C₁₀H₂₀N₂O₄

Color and Shape: Solid

Molecular weight: 232.2768

Ref: IN-DA0032W3

2,2’-(Ethanediyldiimino)bis-Butanoic Acid DiHCl

CAS: 498-17-9

Formula: C₁₀H₂₀N₂O₄·2HCl

Molecular weight: 232.28 2*36.46

Ref: 4Z-B-086053

2,2’-(Ethanediyldiimino)bis-butanoic Acid(Mixture of Diastereomers)

Controlled Product

CAS: 498-17-9

Applications 2,2’-(Ethanediyldiimino)bis-butanoic Acid is used in the treatment of Pb poisoning in humans as a tuberculostatic. It is an impurity in the formation of Ethambutol (E889800). It is an anti-bacterial compound.
References Dam T.B. et al.: Rev. Pharm., 111 (1983); Wilkinson, et al.: J. Med. Chem., 5, 835 (1962); Kulig, et al.: Diss. Pharm. Pharmacol., 23, 463 (1971); Lee, C.S., et al.: Anal. Profiles Drug Subs., 7, 231 (1978);

Formula: C₁₀H₂₀N₂O₄

Color and Shape: Neat

Molecular weight: 232.28

Ref: TR-E890340

Ethambutol Impurity 1

CAS: 498-17-9

Formula: C₁₀H₂₀N₂O₄

Molecular weight: 232.3

Ref: ST-EA-CP-E20012