CAS 498-25-9
:3,4-Diamino-4-oxobutanoic acid
Description:
3,4-Diamino-4-oxobutanoic acid, also known as DABA, is an organic compound characterized by its amino and keto functional groups. It features two amino groups (-NH2) and a ketone group (C=O) within a four-carbon backbone. This compound is typically a white to off-white crystalline solid and is soluble in water due to its polar functional groups. DABA is known for its role in biochemical pathways, particularly in the synthesis of amino acids and as a potential intermediate in various chemical reactions. Its structure allows for participation in hydrogen bonding, which can influence its reactivity and interactions with other molecules. Additionally, DABA may exhibit biological activity, making it of interest in pharmaceutical and biochemical research. Safety data indicates that, like many amino acids and their derivatives, it should be handled with care, as it may pose health risks if ingested or improperly handled. Overall, 3,4-Diamino-4-oxobutanoic acid is a versatile compound with applications in both research and industry.
Formula:C4H8N2O3
InChI:InChI=1S/C4H8N2O3/c5-2(4(6)9)1-3(7)8/h2H,1,5H2,(H2,6,9)(H,7,8)
InChI key:InChIKey=PMLJIHNCYNOQEQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(C(N)=O)N
Synonyms:- 3,4-Diamino-4-oxobutanoic acid
- 3-Amino-3-carbamoylpropanoic acid
- <span class="text-smallcaps">DL</span>-Isoasparagine
- <span class="text-smallcaps">DL</span>-α-Asparagine
- Aspartic acid amide
- Butanoic acid, 3,4-diamino-4-oxo-
- Isoasparagine
- NSC 528893
- Succinamic acid, 3-amino-
- DL-α-Asparagine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
