CAS 49804-34-4

3-amino-N,N-diethyl-4-[(2-hydroxyethyl)amino]benzenesulfonamide

Description:

3-amino-N,N-diethyl-4-[(2-hydroxyethyl)amino]benzenesulfonamide, with the CAS number 49804-34-4, is a chemical compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. The compound contains an amino group and two ethyl groups attached to the nitrogen, indicating its diethyl substitution. Additionally, it has a hydroxyethylamino group, which contributes to its solubility and potential biological activity. The presence of these functional groups suggests that the compound may exhibit properties such as antimicrobial activity, as many sulfonamides are known for their use as antibiotics. Its structure allows for hydrogen bonding, which can influence its interactions in biological systems. The compound is likely to be soluble in polar solvents due to the presence of hydroxyl and amino groups, making it suitable for various applications in medicinal chemistry and pharmaceuticals.

Formula: C₁₂H₂₁N₃O₃S

InChI: InChI=1/C12H21N3O3S/c1-3-15(4-2)19(17,18)10-5-6-12(11(13)9-10)14-7-8-16/h5-6,9,14,16H,3-4,7-8,13H2,1-2H3

SMILES: CCN(CC)S(=O)(=O)c1ccc(c(c1)N)NCCO

3-amino-N,N-diethyl-4-[(2-hydroxyethyl)amino]-Benzenesulfonamide

CAS: 49804-34-4

3-amino-N,N-diethyl-4-[(2-hydroxyethyl)amino]-Benzenesulfonamide

Purity: 95%

Molecular weight: 287.38g/mol

Ref: 54-OR83331

3-amino-N,N-diethyl-4-[(2-hydroxyethyl)amino]-Benzenesulfonamide

CAS: 49804-34-4

Purity: 97%

Molecular weight: 287.3800049

Ref: 10-F643903