CAS 49804-44-6

3-amino-N,N-diethyl-4-(methylamino)benzenesulfonamide

Description:

3-Amino-N,N-diethyl-4-(methylamino)benzenesulfonamide, also known by its CAS number 49804-44-6, is a chemical compound that belongs to the class of sulfonamides. This substance features a sulfonamide functional group, which is characterized by the presence of a sulfonyl (SO2) moiety attached to an amine. The compound contains an amino group and two ethyl groups attached to the nitrogen atom, contributing to its basicity and solubility in polar solvents. The presence of a methylamino group further enhances its potential for hydrogen bonding and reactivity. Typically, sulfonamides exhibit antibacterial properties, and this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it may interact with biological systems, potentially influencing enzyme activity or microbial growth. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₉N₃O₂S

InChI: InChI=1/C11H19N3O2S/c1-4-14(5-2)17(15,16)9-6-7-11(13-3)10(12)8-9/h6-8,13H,4-5,12H2,1-3H3

SMILES: CCN(CC)S(=O)(=O)c1ccc(c(c1)N)NC

3-Amino-N,N-diethyl-4-(methylamino)benzene-1-sulfonamide

CAS: 49804-44-6

Versatile small molecule scaffold

Formula: C₁₁H₁₉N₃O₂S

Purity: Min. 95%

Molecular weight: 257.35 g/mol

Ref: 3D-ZBA80444