CAS 49808-20-0
:6,6'-disulfanediylbis(5H-purine)
Description:
6,6'-Disulfanediylbis(5H-purine), with the CAS number 49808-20-0, is a chemical compound characterized by its unique structure, which features two purine units linked by a disulfide bond. Purines are nitrogen-containing heterocycles that play crucial roles in biochemistry, particularly in the formation of nucleotides and nucleic acids. The presence of the disulfide linkage imparts specific chemical properties, such as increased stability and potential reactivity under oxidative conditions. This compound may exhibit biological activity, potentially influencing cellular processes or serving as a precursor in synthetic pathways. Its solubility, melting point, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many purine derivatives, it may be of interest in pharmaceutical research, particularly in the development of antiviral or anticancer agents. However, detailed studies on its specific applications and biological effects would be necessary to fully understand its potential uses in various fields, including medicinal chemistry and biochemistry.
Formula:C10H6N8S2
InChI:InChI=1/C10H6N8S2/c1-11-5-7(13-1)15-3-17-9(5)19-20-10-6-8(14-2-12-6)16-4-18-10/h1-6H
SMILES:C1=NC2C(=N1)N=CN=C2SSC1=NC=NC2=NC=NC12
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Bis-(1,7-dihydro-6H-purine)-6,6-disulfide
CAS:Bis-(1,7-dihydro-6H-purine)-6,6-disulfideColor and Shape:Yellow To Dark Yellow6-Mercaptopurine Disulfide
CAS:Controlled Product<p>Applications 6-Mercaptopurine Disulfide is an impurity of 6-Mercaptopurine (M225450, monohydrate) which is an immunosuppressive drug used to treat leukemia. It is also used for pediatric non-Hodgkin’s lymphoma, polycythemia vera, and psoriatic arthritis.<br>References Zeng, H., et al.: Biochem. Pharmacol., 68, 911 (2004)<br></p>Formula:C10H6N8S2Color and Shape:Yellow To Dark YellowMolecular weight:302.346-Mercaptopurine disulfide
CAS:<p>Please enquire for more information about 6-Mercaptopurine disulfide including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C10H6N8S2Purity:Min. 95%Molecular weight:302.3 g/mol






