CAS 49809-28-1

{[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid

Description:

The chemical substance known as {[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid, with the CAS number 49809-28-1, is characterized by its unique structural features and functional groups. It contains an oxadiazole ring, which is a five-membered heterocyclic compound featuring nitrogen and oxygen atoms, contributing to its potential biological activity. The presence of a chlorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. The sulfanyl (thioether) group introduces a sulfur atom, which can participate in various chemical reactions and may affect the compound's reactivity and stability. Additionally, the acetic acid moiety provides acidic properties, allowing for potential interactions in biological systems. This compound may exhibit antimicrobial, anti-inflammatory, or other pharmacological activities, making it of interest in medicinal chemistry. Its solubility, melting point, and other physical properties would depend on the specific conditions and solvent used. Overall, this compound represents a class of heterocyclic compounds with diverse applications in pharmaceuticals and agrochemicals.

Formula: C₁₀H₇ClN₂O₃S

InChI: InChI=1/C10H7ClN2O3S/c11-7-3-1-6(2-4-7)9-12-13-10(16-9)17-5-8(14)15/h1-4H,5H2,(H,14,15)

Synonyms:

• acetic acid, 2-[[5-(4-chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]-
• {[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]sulfanyl}acetic acid

2-[[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]acetic acid

CAS: 49809-28-1

2-[[5-(4-Chlorophenyl)-1,3,4-oxadiazol-2-yl]thio]acetic acid

Purity: ≥95%

Molecular weight: 270.69g/mol

Ref: 54-OR85327

[5-(4-Chloro-phenyl)-[1,3,4]oxadiazol-2-ylsulfanyl]-acetic acid

CAS: 49809-28-1

Molecular weight: 270.6900024

Ref: 10-F911775