CAS 49810-41-5
:[(3S,4R,5S,6R)-5-acetamido-3,4-diacetoxy-6-ethylsulfanyl-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4R,5S,6R)-5-acetamido-3,4-diacetoxy-6-ethylsulfanyl-tetrahydropyran-2-yl]methyl acetate" and CAS number 49810-41-5 is a complex organic compound characterized by its tetrahydropyran ring structure, which is a six-membered cyclic ether. This compound features multiple functional groups, including acetamido, diacetoxy, and ethylsulfanyl substituents, contributing to its chemical reactivity and potential biological activity. The stereochemistry indicated by the (3S,4R,5S,6R) configuration suggests specific spatial arrangements of atoms, which can significantly influence the compound's properties and interactions. It is likely to exhibit solubility in organic solvents due to its hydrophobic regions, while the presence of polar functional groups may enhance its solubility in polar solvents. This compound may be of interest in medicinal chemistry or synthetic organic chemistry, potentially serving as an intermediate in the synthesis of more complex molecules or as a candidate for pharmacological studies. Its specific applications would depend on further research into its biological activity and reactivity.
Formula:C16H25NO8S
InChI:InChI=1/C16H25NO8S/c1-6-26-16-13(17-8(2)18)15(24-11(5)21)14(23-10(4)20)12(25-16)7-22-9(3)19/h12-16H,6-7H2,1-5H3,(H,17,18)/t12?,13-,14+,15+,16+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Ethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-a-D-thioglucopyranoside
CAS:<p>Ethyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-a-D-thioglucopyranoside is a sugar derived from the condensation of two molecules of acetamide with three molecules of glucose. It is a synthetic compound that has been modified by fluorination, methylation, and monosaccharide synthesis. This product has been shown to be effective against bacteria and fungi in laboratory studies.</p>Formula:C16H25NO8SPurity:Min. 95%Color and Shape:White To Off-White SolidMolecular weight:391.44 g/mol

