CAS 49830-37-7

1-aminocyclopentanecarbonitrile

Description:

1-Aminocyclopentanecarbonitrile is an organic compound characterized by its unique structure, which includes a cyclopentane ring, an amino group, and a nitrile functional group. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, such as nucleophilic substitutions and condensation reactions. The nitrile group (-C≡N) contributes to the compound's polarity and can influence its reactivity and solubility in polar solvents. This compound is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. Its molecular structure allows for potential applications in pharmaceuticals and organic synthesis, particularly in the development of biologically active molecules. Additionally, the compound's properties, such as boiling point, melting point, and solubility, are influenced by the presence of both the amino and nitrile groups, making it an interesting subject for further study in organic chemistry and materials science.

Formula: C₆H₁₀N₂

InChI: InChI=1/C6H10N2/c7-5-6(8)3-1-2-4-6/h1-4,8H2

InChI key: InChIKey=KFPMRYNOEZCHDP-UHFFFAOYSA-N

SMILES: C(#N)C1(N)CCCC1

Synonyms:

• 1-Amino-1-cyclopentanecarbonitrile
• 1-Cyanocyclopentylamine
• Cyclopentanecarbonitrile, 1-Amino-
• L5Tj Az Acn [Wln]
• 1-Aminocyclopentanecarbonitrile
• 1-aminocyclopentanecarbonitrile(SALTDATA: HCl)
• A80241
• Irbint-A01

1-Aminocyclopentane-1-carbonitrile

CAS: 49830-37-7

Formula: C₆H₁₀N₂

Molecular weight: 110.1570

Ref: IN-DA00DBD8

1-Aminocyclopentane-1-carbonitrile

CAS: 49830-37-7

1-Aminocyclopentane-1-carbonitrile

Purity: 95%

Molecular weight: 110.16g/mol

Ref: 54-OR900461

1-Amino-cyclopentane carbonitrile

CAS: 49830-37-7

1-Amino-cyclopentane carbonitrile is a pharmacological agent that can be used to treat angiotensin II and other peptides. It has an amine group with a hydroxyl group, which allows it to interact with the active site of angiotensin converting enzyme (ACE). 1-Amino-cyclopentane carbonitrile's mechanism of action is based on its ability to react with the halide and phenyl groups in ACE. The hydrolysis of ACE leads to the production of angiotensin I, which is then converted into angiotensin II by angiotensin-converting enzyme 2 (ACE2). 1-Amino-cyclopentane carbonitrile also interacts with amines such as histamine and serotonin, inhibiting their synthesis.

Formula: C₆H₁₀N₂

Purity: Min. 95%

Molecular weight: 110.16 g/mol

Ref: 3D-FA28801