CymitQuimica logo

CAS 49859-70-3

:

2-[Methyl[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)sulfonyl]amino]ethyl 2-propenoate

Description:
2-[Methyl[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)sulfonyl]amino]ethyl 2-propenoate, with the CAS number 49859-70-3, is a fluorinated organic compound characterized by its unique structure that includes a sulfonamide functional group and a propenoate moiety. This compound features a long-chain perfluorinated alkyl group, which imparts hydrophobic and lipophobic properties, making it useful in various applications, including surface coatings and additives. The presence of the sulfonamide group enhances its reactivity and potential for forming stable bonds with other materials. Additionally, the propenoate group suggests that it can participate in polymerization reactions, allowing for the synthesis of fluorinated polymers. The compound's fluorinated nature contributes to its thermal stability and resistance to chemical degradation, making it suitable for use in harsh environments. Overall, its unique combination of properties makes it valuable in specialized industrial applications, particularly in fields requiring water and oil repellency.
Formula:C14H14F13NO4S
InChI:InChI=1S/C14H14F13NO4S/c1-3-8(29)32-6-5-28(2)33(30,31)7-4-9(15,16)10(17,18)11(19,20)12(21,22)13(23,24)14(25,26)27/h3H,1,4-7H2,2H3
InChI key:InChIKey=HATNGDPVYXXGKR-UHFFFAOYSA-N
SMILES:C(C(C(C(F)(F)F)(F)F)(F)F)(C(C(CCS(N(CCOC(C=C)=O)C)(=O)=O)(F)F)(F)F)(F)F
Synonyms:
  • 2-Propenoic acid, 2-(methyl((3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)sulfonyl)amino)ethyl ester
  • 2-[Methyl[(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)sulfonyl]amino]ethyl 2-propenoate
  • 2-{Methyl[(3,3,4,4,5,5,6,6,7,7,8,8,8-Tridecafluorooctyl)Sulfonyl]Amino}Ethyl Prop-2-Enoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.