CAS 499-05-8
:Comanicacid
Description:
Comanic acid, with the CAS number 499-05-8, is a naturally occurring organic compound classified as a bicyclic compound. It is primarily derived from certain plant sources and is known for its role in various biological processes. The structure of comanic acid features a bicyclo[3.3.0]octane framework, which contributes to its unique chemical properties. This compound is characterized by its ability to participate in various chemical reactions, including esterification and oxidation, making it of interest in organic synthesis and medicinal chemistry. Comanic acid exhibits moderate solubility in organic solvents, while its solubility in water is limited. Additionally, it has been studied for its potential applications in pharmaceuticals and as a biochemical marker. Its biological activity may include antimicrobial and anti-inflammatory properties, although further research is necessary to fully elucidate its mechanisms of action and potential therapeutic uses. Overall, comanic acid represents a fascinating subject of study within the field of organic chemistry and natural product research.
Formula:C6H4O4
InChI:InChI=1/C6H4O4/c7-4-1-2-10-5(3-4)6(8)9/h1-3H,(H,8,9)
SMILES:c1coc(cc1=O)C(=O)O
Synonyms:- Comanic acid
- 4-oxo-4H-pyran-2-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Comanic Acid
CAS:Formula:C6H4O4Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow to Light orange powder to crystalMolecular weight:140.094-Oxo-4H-Pyran-2-Carboxylic Acid
CAS:Formula:C6H4O4Purity:95%Color and Shape:SolidMolecular weight:140.0936Ref: IN-DA003P1I
1g43.00€5g122.00€10g163.00€25g322.00€50g585.00€100gTo inquire250gTo inquire250mg25.00€Comanic acid
CAS:Formula:C6H4O4Purity:96%Color and Shape:White to pale reddish yellow crystal powderMolecular weight:140.094Comanic acid
CAS:Comanic acid is an organic compound that is a derivative of pyridinium. It can be synthesized from acetyl chloride and pyridine by reaction with silver ions in the presence of ethyl esters. Comanic acid has been shown to have anticholinergic activity and inhibit prostatic hypertrophy in rats. It is metabolized to propantheline, which has been shown to be a molecule that binds to chemokine receptors, inhibiting chemotaxis of activated T lymphocytes.Formula:C6H4O4Purity:Min. 95%Color and Shape:White To Yellow To Red SolidMolecular weight:140.09 g/mol




