CAS 499-24-1
:Glucocochlearin
Description:
Glucocochlearin, with the CAS number 499-24-1, is a chemical compound that belongs to the class of glucosides, specifically a type of glycoside derived from cochlearin. It is characterized by its structure, which typically includes a glucose moiety linked to a non-sugar component, contributing to its biological activity. This compound is often studied for its potential pharmacological properties, including its role in plant defense mechanisms and its effects on human health. Glucocochlearin is soluble in water and exhibits stability under various conditions, making it suitable for various applications in research and industry. Its presence in certain plants suggests a role in the plant's metabolic processes and interactions with herbivores or pathogens. As with many glycosides, glucocochlearin may undergo hydrolysis to release its aglycone, which can have distinct biological effects. Further research is necessary to fully elucidate its mechanisms of action and potential therapeutic applications.
Formula:C11H21NO9S2
InChI:InChI=1S/C11H21NO9S2/c1-3-5(2)10(12-21-23(17,18)19)22-11-9(16)8(15)7(14)6(4-13)20-11/h5-9,11,13-16H,3-4H2,1-2H3,(H,17,18,19)/t5?,6-,7-,8+,9-,11+/m1/s1
InChI key:InChIKey=TUSWQPFNQXCPGB-FUYPYFFWSA-N
SMILES:S(C(=NOS(=O)(=O)O)C(CC)C)[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O
Synonyms:- 2-Butylglucosinolate
- β-D-Glucopyranose, 1-thio-, 1-[2-methyl-N-(sulfooxy)butanimidate]
- Glucopyranose, 1-thio-, 1-(2-methylbutyrohydroximate) NO-(hydrogen sulfate), β-D-
- Glucocochlearin
- 1-Methylpropyl glucosinolate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
