CAS 499-61-6
:2-Amino-1-(3,4-dihydroxyphenyl)ethanone
Description:
2-Amino-1-(3,4-dihydroxyphenyl)ethanone, also known as dopamine, is a catecholamine and an important neurotransmitter in the brain. It is characterized by its amino group (-NH2) and a ketone functional group (C=O) attached to a two-carbon ethyl chain, along with a dihydroxyphenyl group that contributes to its reactivity and biological activity. This compound is soluble in water due to its polar functional groups, which facilitate hydrogen bonding. Dopamine plays a crucial role in various physiological processes, including mood regulation, motor control, and the reward system. It is synthesized in the body from the amino acid tyrosine and is involved in several neurological disorders when imbalances occur. The compound exhibits antioxidant properties and can participate in redox reactions due to its catechol structure. Its chemical stability is influenced by pH and temperature, and it can undergo oxidation, leading to the formation of various metabolites. Overall, 2-Amino-1-(3,4-dihydroxyphenyl)ethanone is a vital substance in both biochemistry and pharmacology.
Formula:C8H9NO3
InChI:InChI=1S/C8H9NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,10-11H,4,9H2
InChI key:InChIKey=CNFQARFTXUBHJY-UHFFFAOYSA-N
SMILES:C(CN)(=O)C1=CC(O)=C(O)C=C1
Synonyms:- 2-Amino-1-(3,4-Dihydroxyphenyl)Ethanone Hydrochloride (1:1)
- 2-Amino-1-(3,4-dihydroxyphenyl)ethanone
- 2-Amino-3',4'-dihydroxyacetophenone
- 2-Amino-3′,4′-dihydroxyacetophenone
- Acetophenone, 2-amino-3',4'-dihydroxy-
- Acetophenone, 2-amino-3′,4′-dihydroxy-
- Arterenon
- Arterenone
- Brn 2719260
- Ethanone, 2-amino-1-(3,4-dihydroxyphenyl)-
- Noradrenalone
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.


