CAS 499-76-3
:4-Hydroxy-3-methylbenzoic acid
Description:
4-Hydroxy-3-methylbenzoic acid, also known as gentisic acid, is an aromatic compound characterized by a hydroxyl group and a carboxylic acid functional group attached to a methyl-substituted benzene ring. Its molecular formula is C8H8O3, and it features a phenolic structure that contributes to its chemical reactivity and solubility properties. This compound typically appears as a white to pale yellow crystalline solid and is soluble in water, alcohol, and other polar solvents. It exhibits weak acidity due to the presence of the carboxylic acid group, and its hydroxyl group can participate in hydrogen bonding, enhancing its solubility in polar environments. 4-Hydroxy-3-methylbenzoic acid is known for its antioxidant properties and potential applications in pharmaceuticals and cosmetics. Additionally, it can serve as an intermediate in organic synthesis and is studied for its role in various biochemical processes. Its CAS number, 499-76-3, is used for identification in chemical databases and regulatory contexts.
Formula:C8H8O3
InChI:InChI=1S/C8H8O3/c1-5-4-6(8(10)11)2-3-7(5)9/h2-4,9H,1H3,(H,10,11)
InChI key:InChIKey=LTFHNKUKQYVHDX-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(C)=C(O)C=C1
Synonyms:- 3-Methyl-4-hydroxybenzoic acid
- 4,3-Cresotic acid
- 4-Hydroxy-m-toluic acid
- Benzoic acid, 4-hydroxy-3-methyl-
- 4-Hydroxy-3-methylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
4-Hydroxy-3-methylbenzoic Acid
CAS:Formula:C8H8O3Purity:98%Color and Shape:SolidMolecular weight:152.14734-hydroxy-3-methylbenzoic acid
CAS:4-hydroxy-3-methylbenzoic acidPurity:≥98%Molecular weight:152.15g/mol4-Hydroxy-3-methylbenzoic Acid
CAS:Formula:C8H8O3Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:152.154-hydroxy-3-methylbenzoic acid
CAS:4-hydroxy-3-methylbenzoic acid (4,3-Cresotic acid) is a organic acid identified in urine specimens from a healthy population.
Formula:C8H8O3Purity:99.69%Color and Shape:SolidMolecular weight:152.154-Hydroxy-3-methylbenzoic acid
CAS:4-Hydroxy-3-methylbenzoic acid
Purity:98%Molecular weight:152.15g/mol4-Hydroxy-3-methylbenzoic acid
CAS:Formula:C8H8O3Purity:98%Color and Shape:SolidMolecular weight:152.1494-Hydroxy-3-methylbenzoic acid
CAS:4-Hydroxy-3-methylbenzoic acid is a metabolite of 4-hydroxybenzoic acid that is found in human blood and serum. It is also a methylated derivative of benzoic acid. This compound is an intermediate in the metabolism of benzoic acid, which can be found in many plants such as cranberries, apples, and oranges.Formula:C8H8O3Color and Shape:PowderMolecular weight:152.15 g/mol





