CAS 499-80-9: 2,4-Pyridinedicarboxylic acid
Description:2,4-Pyridinedicarboxylic acid, also known as quinaldic acid, is an organic compound with the molecular formula C7H7N O4. It features a pyridine ring substituted with two carboxylic acid groups at the 2 and 4 positions. This compound is typically a white to light yellow crystalline solid that is soluble in water and polar organic solvents. It exhibits acidic properties due to the presence of the carboxylic acid groups, which can donate protons in solution. 2,4-Pyridinedicarboxylic acid is known for its applications in the synthesis of various pharmaceuticals, agrochemicals, and as a ligand in coordination chemistry. Its ability to chelate metal ions makes it useful in catalysis and materials science. Additionally, it can participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis. Safety data indicates that it should be handled with care, as it may cause irritation to the skin and eyes.
Formula:C7H5NO4
InChI:InChI=1S/C7H5NO4/c9-6(10)4-1-2-8-5(3-4)7(11)12/h1-3H,(H,9,10)(H,11,12)
InChI key:InChIKey=MJIVRKPEXXHNJT-UHFFFAOYSA-N
SMILES:O=C(O)C1=NC=CC(=C1)C(=O)O
- Synonyms:
- 2,4-Dicarboxylpyridine
- 2,4-Lutidinic acid
- 2,4-Pyridinedicarboxylic acid hydrate
- Lutidinic Acid
- Nsc 403248
- Pyridine-2,4-dicarboxylic acid
- 2,4-Pyridinedicarboxylic acid
