CAS 4990-81-2
:6-chloro-6-deoxyhexose
Description:
6-Chloro-6-deoxyhexose is a monosaccharide derivative characterized by the presence of a chlorine atom at the sixth carbon position and the absence of a hydroxyl group at that same position, which distinguishes it from typical hexoses. This compound is a sugar alcohol and is part of the broader category of deoxy sugars, which are sugars that have lost one or more hydroxyl groups. The chemical structure of 6-chloro-6-deoxyhexose contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. It may exhibit different physical properties compared to its parent hexose, such as altered solubility and reactivity due to the presence of the chlorine substituent. Additionally, the compound's biological activity can be influenced by its structural modifications, making it of interest in research related to carbohydrate chemistry and potential pharmaceutical applications. As with many chlorinated compounds, considerations regarding toxicity and environmental impact are important in its handling and use.
Formula:C6H11ClO5
InChI:InChI=1/C6H11ClO5/c7-1-3(9)5(11)6(12)4(10)2-8/h2-6,9-12H,1H2
SMILES:C(C(C(C(C(C=O)O)O)O)O)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
6-Chloro-6-deoxy-D-mannose
CAS:6-Chloro-6-deoxy-D-mannose is a naturally occurring sugar that is found in the spermatozoa of many animals. It is a mannose derivative that has been shown to be an inhibitor of the enzyme glyceraldehyde 3-phosphate dehydrogenase, which plays an important role in energy metabolism and isomerization of 6-phosphate to glucose-1 phosphate. This property may be responsible for its contraceptive effects. The drug also inhibits phosphoglucomutase and enhances the transfer of glucose from the liver to other tissues, increasing blood glucose concentrations. 6-Chloro-6 deoxy mannose also has antifertility effects in rats by inhibiting transfer of spermatozoa through the female reproductive tract.Formula:C6H11ClO5Purity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:198.6 g/mol
