CAS 499158-97-3: 2-hexyl-6-phenyl-pyridine

Description:2-Hexyl-6-phenyl-pyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. This compound features a hexyl group and a phenyl group attached to the pyridine ring, contributing to its unique properties. The presence of the hexyl group enhances its hydrophobic characteristics, while the phenyl group adds to its aromatic nature, potentially influencing its reactivity and solubility. 2-Hexyl-6-phenyl-pyridine may exhibit interesting electronic properties due to the conjugation between the aromatic systems, making it a candidate for applications in organic electronics or as a ligand in coordination chemistry. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic substitutions or coordination with metal ions. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by the size and nature of the substituents on the pyridine ring. Overall, 2-hexyl-6-phenyl-pyridine is a versatile compound with potential applications in various fields of chemistry.

Formula:C₁₇H₂₁N

InChI:InChI=1/C17H21N/c1-2-3-4-8-12-16-13-9-14-17(18-16)15-10-6-5-7-11-15/h5-7,9-11,13-14H,2-4,8,12H2,1H3

Synonyms:
2-Hexyl-6-phenylpyridine
Pyridine, 2-Hexyl-6-Phenyl-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
2-Hexyl-6-phenylpyridine REF: 3B-H1265CAS: 499158-97-3	>98.0%(GC)(T)	233.00 €	Tue 22 Apr 25
2-Hexyl-6-phenylpyridine REF: IN-DA003HD6CAS: 499158-97-3	98.0%	188.00 €~228.00 €	Tue 29 Apr 25
2-Hexyl-6-phenylpyridine REF: 3D-ZUA15897CAS: 499158-97-3	Min. 95%	- - -	Discontinued product