CAS 4994-86-9

4-chloro-2-methylpyrimidine

Description:

4-Chloro-2-methylpyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a chlorine atom at the 4-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its physical state. It is soluble in organic solvents such as ethanol and ether but has limited solubility in water. 4-Chloro-2-methylpyrimidine is known for its applications in pharmaceuticals and agrochemicals, often serving as an intermediate in the synthesis of various biologically active compounds. Its reactivity is influenced by the electron-withdrawing nature of the chlorine atom, which can participate in nucleophilic substitution reactions. Additionally, the compound may exhibit antimicrobial and herbicidal properties, making it of interest in both medicinal chemistry and agricultural applications. Proper handling and safety measures should be observed due to its potential toxicity.

Formula: C₅H₅ClN₂

InChI: InChI=1/C5H5ClN2/c1-4-7-3-2-5(6)8-4/h2-3H,1H3

SMILES: Cc1nccc(Cl)n1

Synonyms:

• Pyrimidine, 4-Chloro-2-Methyl-

4-Chloro-2-methylpyrimidine

CAS: 4994-86-9

Formula: C₅H₅ClN₂

Purity: 95%

Color and Shape: Liquid

Molecular weight: 128.5596

Ref: IN-DA00D966

4-Chloro-2-methylpyrimidine

CAS: 4994-86-9

Formula: C₅H₅ClN₂

Purity: >98.0%(GC)

Color and Shape: White to Brown powder to crystal

Molecular weight: 128.56

Ref: 3B-C2835

4-Chloro-2-methylpyrimidine

CAS: 4994-86-9

4-Chloro-2-methylpyrimidine

Purity: 96%

Color and Shape: Solid

Molecular weight: 128.56g/mol

Ref: 54-OR950972

4-Chloro-2-methyl-pyrimidine

CAS: 4994-86-9

Formula: C₅H₅ClN₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 128.56

Ref: 10-F061014