CAS 4994-89-2

5,6-dimethylthieno[2,3-d]pyrimidin-4-amine

Description:

5,6-Dimethylthieno[2,3-d]pyrimidin-4-amine is a heterocyclic organic compound characterized by its fused thieno and pyrimidine rings, which contribute to its unique chemical properties. The presence of two methyl groups at the 5 and 6 positions enhances its lipophilicity and may influence its biological activity. This compound typically exhibits moderate solubility in organic solvents and may have limited solubility in water, which is common for many heterocycles. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as compounds with similar frameworks have been investigated for their roles as kinase inhibitors or in other therapeutic areas. The amine functional group at the 4 position can participate in hydrogen bonding, making it a potential candidate for interactions with biological targets. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the thieno and pyrimidine moieties, which may affect its synthesis and functionalization in various chemical reactions.

Formula: C₈H₉N₃S

InChI: InChI=1/C8H9N3S/c1-4-5(2)12-8-6(4)7(9)10-3-11-8/h3H,1-2H3,(H2,9,10,11)

SMILES: Cc1c(C)sc2c1c(N)ncn2

Synonyms:

• 5,6-Dimethyl-thieno[2,3-d]pyrimidin-4-ylamine
• Thieno[2,3-d]pyrimidin-4-amine, 5,6-dimethyl-
• 5,6-Dimethylthieno[2,3-d]pyrimidin-4-amine

5,6-DIMETHYL-THIENO[2,3-D]PYRIMIDIN-4-YLAMINE

CAS: 4994-89-2

Formula: C₈H₉N₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.2422

Ref: IN-DA00DCX1

5,6-dimethylthieno[2,3-d]pyrimidin-4-amine

CAS: 4994-89-2

Formula: C₈H₉N₃S

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.24

Ref: 10-F311275

5,6-Dimethylthieno[2,3-d]pyrimidin-4-amine

CAS: 4994-89-2

5,6-Dimethylthieno[2,3-d]pyrimidin-4-amine is an ester of sucralose. It is a sweetener that can be used in sweetner compositions or solvates. 5,6-Dimethylthieno[2,3-d]pyrimidin-4-amine is an intermediate in the synthesis of sucralose.

Formula: C₈H₉N₃S

Purity: Min. 95%

Molecular weight: 179.24 g/mol

Ref: 3D-EAA99489