CymitQuimica logo

CAS 4996-15-0

:

3-(3-nitrophenyl)prop-2-ynoic acid

Description:
3-(3-Nitrophenyl)prop-2-ynoic acid, with the CAS number 4996-15-0, is an organic compound characterized by its unique structure that includes a propyne moiety and a nitrophenyl group. This compound features a triple bond between the second and third carbon atoms of the propynoic acid chain, contributing to its reactivity and potential applications in organic synthesis. The presence of the nitro group on the aromatic ring enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The carboxylic acid functional group imparts acidic characteristics, allowing it to participate in acid-base reactions. Additionally, this compound may exhibit interesting biological activities, which can be explored for potential pharmaceutical applications. Its solubility and stability can vary depending on the solvent and conditions, making it essential to consider these factors in practical applications. Overall, 3-(3-nitrophenyl)prop-2-ynoic acid is a versatile compound with significant implications in synthetic organic chemistry and medicinal chemistry.
Formula:C9H5NO4
InChI:InChI=1/C9H5NO4/c11-9(12)5-4-7-2-1-3-8(6-7)10(13)14/h1-3,6H,(H,11,12)
SMILES:c1cc(C#CC(=O)O)cc(c1)N(=O)=O
Synonyms:
  • 2-Propynoic acid, 3-(3-nitrophenyl)-
  • 3-(3-Nitrophenyl)prop-2-ynoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.