CAS 499771-07-2

1-benzyl-4-(3-nitropyridin-2-yl)piperazine

Description:

1-Benzyl-4-(3-nitropyridin-2-yl)piperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The compound features a benzyl group attached to one nitrogen of the piperazine and a 3-nitropyridine moiety linked to the fourth position of the piperazine ring. This structure contributes to its potential biological activity, as both the benzyl and nitropyridine groups can participate in various interactions with biological targets. The presence of the nitro group introduces polarity and may influence the compound's solubility and reactivity. Typically, compounds like this are studied for their pharmacological properties, including potential applications in neuropharmacology or as therapeutic agents. The molecular weight, solubility, and specific reactivity would depend on the compound's overall structure and functional groups. As with many piperazine derivatives, it may exhibit a range of biological activities, making it of interest in medicinal chemistry and drug development.

Formula: C₁₆H₁₈N₄O₂

InChI: InChI=1/C16H18N4O2/c21-20(22)15-7-4-8-17-16(15)19-11-9-18(10-12-19)13-14-5-2-1-3-6-14/h1-8H,9-13H2

SMILES: c1ccc(cc1)CN1CCN(CC1)c1c(cccn1)N(=O)=O

1-Benzyl-4-(3-nitropyridin-2-yl)piperazine

CAS: 499771-07-2

1-Benzyl-4-(3-nitropyridin-2-yl)piperazine

Purity: ≥95%

Molecular weight: 298.34g/mol

Ref: 54-OR110694