CAS 499771-17-4

2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile

Description:

2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile, identified by its CAS number 499771-17-4, is a chemical compound characterized by its complex structure that includes a thiazole ring and a benzodioxin moiety. This compound typically exhibits properties associated with both heterocyclic and aromatic compounds, which may influence its reactivity and interactions in various chemical environments. The presence of the acetonitrile functional group suggests potential polar characteristics, which can enhance solubility in polar solvents. Additionally, the thiazole ring may contribute to biological activity, making this compound of interest in medicinal chemistry and drug development. Its unique structural features may also allow for specific interactions with biological targets, potentially leading to therapeutic applications. As with many organic compounds, the stability, reactivity, and potential applications of this substance would depend on its specific molecular interactions and the conditions under which it is used.

Formula: C₁₃H₁₀N₂O₂S

InChI: InChI=1/C13H10N2O2S/c14-4-3-13-15-10(8-18-13)9-1-2-11-12(7-9)17-6-5-16-11/h1-2,7-8H,3,5-6H2

SMILES: c1cc2c(cc1c1csc(CC#N)n1)OCCO2

Synonyms:

• [4-(2,3-Dihydro-1,4-Benzodioxin-6-Yl)-1,3-Thiazol-2-Yl]Acetonitrile

2-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile

CAS: 499771-17-4

2-[4-(2,3-Dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile

Purity: ≥95%

Molecular weight: 258.30g/mol

Ref: 54-OR96752

2-(4-(2,3-Dihydrobenzo[b][1,4]dioxin-6-yl)thiazol-2-yl)acetonitrile

CAS: 499771-17-4

Purity: 98%

Molecular weight: 258.29998779296875

Ref: 10-F729914