CymitQuimica logo

CAS 499771-22-1

:

β,β-Dimethyl-1H-pyrrole-1-ethanol

Description:
β,β-Dimethyl-1H-pyrrole-1-ethanol is an organic compound characterized by its pyrrole ring structure, which is a five-membered aromatic heterocycle containing nitrogen. This compound features two methyl groups attached to the β-position of the pyrrole ring, contributing to its unique chemical properties. The presence of the hydroxyl (-OH) group at the 1-position of the pyrrole enhances its reactivity and solubility in polar solvents. This compound is likely to exhibit moderate to high polarity due to the hydroxyl group, making it suitable for various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. Additionally, the presence of the dimethyl substituents can influence its steric hindrance and electronic properties, potentially affecting its reactivity and interactions with other molecules. β,β-Dimethyl-1H-pyrrole-1-ethanol may find applications in organic synthesis, pharmaceuticals, or as a building block in the development of more complex chemical entities. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C8H13NO
InChI:InChI=1S/C8H13NO/c1-8(2,7-10)9-5-3-4-6-9/h3-6,10H,7H2,1-2H3
InChI key:InChIKey=LPIKPFDHQPUHMF-UHFFFAOYSA-N
SMILES:C(CO)(C)(C)N1C=CC=C1
Synonyms:
  • 2-Methyl-2-(1H-pyrrol-1-yl)propan-1-ol
  • β,β-Dimethyl-1H-pyrrole-1-ethanol
  • 1H-Pyrrole-1-ethanol, β,β-dimethyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.